The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-amino-4-[[(2R,3R,4S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-tetrahydrofuran-2-yl]methoxy]phenyl]-piperazin-1-yl-methanone ID: ALA5094620
PubChem CID: 166632521
Max Phase: Preclinical
Molecular Formula: C22H26FN7O4
Molecular Weight: 471.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1cc(OC[C@H]2O[C@@H](n3ccc4c(N)ncnc43)[C@@H](F)[C@@H]2O)ccc1C(=O)N1CCNCC1
Standard InChI: InChI=1S/C22H26FN7O4/c23-17-18(31)16(34-22(17)30-6-3-14-19(25)27-11-28-20(14)30)10-33-12-1-2-13(15(24)9-12)21(32)29-7-4-26-5-8-29/h1-3,6,9,11,16-18,22,26,31H,4-5,7-8,10,24H2,(H2,25,27,28)/t16-,17+,18-,22-/m1/s1
Standard InChI Key: BAFAQOCPQINWRE-WYADAEROSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.2547 -1.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9693 -1.0461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5429 -1.0465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5429 -0.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2529 0.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9693 -0.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0807 0.9929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9318 0.3267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2643 1.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6799 0.1925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5018 0.6304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8139 0.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0263 -0.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8453 -0.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1392 0.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0214 0.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5588 -0.1840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3514 0.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5646 0.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3580 1.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9342 0.4535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9318 -0.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7218 -0.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4460 -1.1886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2556 -1.3619 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.3020 -0.9195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7268 0.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3070 0.0856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9392 1.4584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0947 -0.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6749 -1.2870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4675 -1.0747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.6799 -0.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0996 0.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
2 6 1 0
5 7 1 0
4 8 1 0
9 8 1 0
9 7 2 0
6 10 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
11 15 1 0
15 8 1 1
12 16 1 1
16 17 1 0
17 18 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 18 2 0
23 22 1 0
23 21 2 0
13 24 1 6
14 25 1 1
23 26 1 0
21 27 1 0
27 28 1 0
27 29 2 0
30 28 1 0
31 30 1 0
32 31 1 0
33 32 1 0
34 33 1 0
28 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.49Molecular Weight (Monoisotopic): 471.2030AlogP: 0.32#Rotatable Bonds: 5Polar Surface Area: 153.78Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.71CX Basic pKa: 7.99CX LogP: 0.53CX LogD: -0.08Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -0.19
References 1. (2021) Mettl3 modulators,