The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 1-(2-hydroxypropyl)-5-(3-(2-(trifluoromethyl)benzyl)ureido)-1H-pyrazole-4-carboxylate ID: ALA5094747
PubChem CID: 155811108
Max Phase: Preclinical
Molecular Formula: C18H21F3N4O4
Molecular Weight: 414.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1cnn(CC(C)O)c1NC(=O)NCc1ccccc1C(F)(F)F
Standard InChI: InChI=1S/C18H21F3N4O4/c1-3-29-16(27)13-9-23-25(10-11(2)26)15(13)24-17(28)22-8-12-6-4-5-7-14(12)18(19,20)21/h4-7,9,11,26H,3,8,10H2,1-2H3,(H2,22,24,28)
Standard InChI Key: JQRVWFSFQNOZMF-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
35.7074 -6.2981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7062 -7.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4143 -7.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1239 -7.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1211 -6.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4125 -5.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8273 -5.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5365 -6.2892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2427 -5.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9519 -6.2838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2396 -5.0607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9458 -4.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6902 -4.9799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.2347 -4.3705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.8234 -3.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0248 -3.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4143 -3.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5796 -2.4938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9691 -1.9505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1344 -1.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6386 -3.5511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.8621 -5.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6399 -6.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8118 -6.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2458 -5.4811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4100 -5.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1165 -4.6614 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.7011 -4.6656 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.4022 -4.2510 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
17 21 2 0
13 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
6 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.38Molecular Weight (Monoisotopic): 414.1515AlogP: 2.78#Rotatable Bonds: 7Polar Surface Area: 105.48Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.11CX Basic pKa: 0.73CX LogP: 2.96CX LogD: 2.96Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.60Np Likeness Score: -1.69
References 1. Morretta E, Sidibè A, Spallarossa A, Petrella A, Meta E, Bruno O, Monti MC, Brullo C.. (2021) Synthesis, functional proteomics and biological evaluation of new 5-pyrazolyl ureas as potential anti-angiogenic compounds., 226 [PMID:34600191 ] [10.1016/j.ejmech.2021.113872 ]