The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N2-((4-[4-mercapto)butoxy]-phenyl)-acetyl)-L-lysyl-N-trans-(4-aminomethyl)-cyclohexyl-guanidine-L-lysine ID: ALA5094815
PubChem CID: 166635874
Max Phase: Preclinical
Molecular Formula: C32H56N8O4S
Molecular Weight: 648.92
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)N[C@H]1CC[C@H](CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)Cc2ccc(OCCCCS)cc2)CC1
Standard InChI: InChI=1S/C32H56N8O4S/c33-17-3-1-7-27(30(42)37-22-24-9-13-25(14-10-24)38-32(35)36)40-31(43)28(8-2-4-18-34)39-29(41)21-23-11-15-26(16-12-23)44-19-5-6-20-45/h11-12,15-16,24-25,27-28,45H,1-10,13-14,17-22,33-34H2,(H,37,42)(H,39,41)(H,40,43)(H4,35,36,38)/t24-,25-,27-,28-/m0/s1
Standard InChI Key: KFYUSIMGVHJRFW-XEZODYMFSA-N
Molfile:
RDKit 2D
45 46 0 0 0 0 0 0 0 0999 V2000
6.6971 -5.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6959 -6.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4040 -7.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1136 -6.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1108 -5.9066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4022 -5.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9879 -7.1377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2805 -6.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5725 -7.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8651 -6.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1571 -7.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4497 -6.7263 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.8170 -5.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5262 -5.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2324 -5.4900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9416 -5.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5293 -6.7184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6478 -5.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3570 -5.8906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0632 -5.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6447 -4.6674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9447 -6.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2385 -7.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2416 -7.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5355 -8.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5385 -9.1700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7724 -5.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4786 -5.4740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1878 -5.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7755 -6.7024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8940 -5.4686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0601 -4.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7663 -4.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7632 -3.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4694 -3.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4663 -2.2052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6069 -5.8790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3110 -5.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3121 -4.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6030 -4.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8928 -4.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0199 -4.2451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7276 -4.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4353 -4.2451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7275 -5.4709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
5 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
18 21 2 0
16 22 1 6
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
20 27 1 0
27 28 1 0
28 29 1 0
27 30 2 0
31 29 1 6
20 32 1 1
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
31 37 1 0
31 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
39 42 1 1
42 43 1 0
43 44 1 0
43 45 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 648.92Molecular Weight (Monoisotopic): 648.4145AlogP: 1.70#Rotatable Bonds: 22Polar Surface Area: 210.47Molecular Species: BASEHBA: 8HBD: 9#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 11#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.19CX Basic pKa: 11.98CX LogP: 1.37CX LogD: -6.22Aromatic Rings: 1Heavy Atoms: 45QED Weighted: 0.04Np Likeness Score: -0.23
References 1. Schroeder B, Demirel P, Fischer C, Masri E, Kallis S, Redl L, Rudolf T, Bergemann S, Arkona C, Nitsche C, Bartenschlager R, Rademann J.. (2021) Nanoparticular Inhibitors of Flavivirus Proteases from Zika, West Nile and Dengue Virus Are Cell-Permeable Antivirals., 12 (12.0): [PMID:34917260 ] [10.1021/acsmedchemlett.1c00515 ]