The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S,4R,5R,6R)-5-Acetamido-2-(acetoxymethyl)-6-((S)-3-((E)-4-(dimethylamino)but-2-enamido)-4-oxo-4-(propylamino)butanamido)tetrahydro-2H-pyran-3,4-diyldiacetate ID: ALA5094865
PubChem CID: 152169333
Max Phase: Preclinical
Molecular Formula: C27H43N5O11
Molecular Weight: 613.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=O)[C@H](CC(=O)N[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O)NC(=O)/C=C/CN(C)C
Standard InChI: InChI=1S/C27H43N5O11/c1-8-11-28-26(39)19(30-21(37)10-9-12-32(6)7)13-22(38)31-27-23(29-15(2)33)25(42-18(5)36)24(41-17(4)35)20(43-27)14-40-16(3)34/h9-10,19-20,23-25,27H,8,11-14H2,1-7H3,(H,28,39)(H,29,33)(H,30,37)(H,31,38)/b10-9+/t19-,20+,23+,24+,25+,27+/m0/s1
Standard InChI Key: VOWXNLSKLOOIGD-AIJHPSTLSA-N
Molfile:
RDKit 2D
43 43 0 0 0 0 0 0 0 0999 V2000
0.3602 0.0021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3537 -0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0722 0.0021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7860 -0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7860 -1.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0722 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3537 -1.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3602 -1.6513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0722 -2.4781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4999 -1.6514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4999 0.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 -0.4094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9289 0.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6439 -0.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9289 0.8289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3577 -2.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3577 -3.7157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3568 -2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4988 -2.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2128 -2.8899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7844 -2.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0752 -1.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7891 -1.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0752 -0.4147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3591 0.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0731 1.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3553 1.2397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 2.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7859 2.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3575 2.4781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7849 3.3041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5004 2.0666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2149 2.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9294 2.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6439 2.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3575 3.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3569 3.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 3.7157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0714 3.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7858 3.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5004 3.3032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 3.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5004 2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
2 7 1 0
7 6 1 0
7 8 1 6
6 9 1 1
5 10 1 6
4 11 1 1
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
9 16 1 0
16 17 2 0
16 18 1 0
10 19 1 0
19 20 2 0
19 21 1 0
8 22 1 0
22 23 1 0
22 24 2 0
1 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
28 30 1 6
29 31 2 0
29 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
30 36 1 0
36 37 1 0
36 38 2 0
37 39 2 0
39 40 1 0
40 41 1 0
41 42 1 0
41 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 613.67Molecular Weight (Monoisotopic): 613.2959AlogP: -1.72#Rotatable Bonds: 15Polar Surface Area: 207.77Molecular Species: BASEHBA: 12HBD: 4#RO5 Violations: 2HBA (Lipinski): 16HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.55CX Basic pKa: 8.81CX LogP: -2.50CX LogD: -3.92Aromatic Rings: ┄Heavy Atoms: 43QED Weighted: 0.09Np Likeness Score: 0.47
References 1. (2021) Inhibition of ngly1 for the treatment of cancer,