The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(((4-((4,4-Dimethylpiperidin-1-yl)methyl)phenyl)amino)-methyl)-1-(6-(methylamino)pyrimidin-4-yl)piperidin-4-ol ID: ALA5094929
PubChem CID: 166634161
Max Phase: Preclinical
Molecular Formula: C25H38N6O
Molecular Weight: 438.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNc1cc(N2CCC(O)(CNc3ccc(CN4CCC(C)(C)CC4)cc3)CC2)ncn1
Standard InChI: InChI=1S/C25H38N6O/c1-24(2)8-12-30(13-9-24)17-20-4-6-21(7-5-20)27-18-25(32)10-14-31(15-11-25)23-16-22(26-3)28-19-29-23/h4-7,16,19,27,32H,8-15,17-18H2,1-3H3,(H,26,28,29)
Standard InChI Key: YCABBSGDIBKFRJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
21.6432 -2.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8260 -2.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2346 -3.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9234 -4.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9222 -5.1985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6303 -5.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3399 -5.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3371 -4.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6285 -3.9701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0433 -3.9641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7560 -4.3706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4601 -3.9628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4612 -3.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7521 -2.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0419 -3.1466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1689 -2.7367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8766 -3.1453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5843 -2.7367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2943 -3.1511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0015 -2.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0019 -1.9251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2893 -1.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5850 -1.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6301 -6.4246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9222 -6.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7091 -1.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4174 -1.9233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4133 -2.7414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1175 -3.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8280 -1.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1193 -1.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4536 -2.3278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
6 24 1 0
24 25 1 0
21 26 1 0
26 27 1 0
27 28 1 0
27 31 1 0
28 29 1 0
29 2 1 0
2 30 1 0
30 31 1 0
13 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.62Molecular Weight (Monoisotopic): 438.3107AlogP: 3.58#Rotatable Bonds: 7Polar Surface Area: 76.55Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.57CX LogP: 2.71CX LogD: 0.39Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.01
References 1. Dolbois A, Bedi RK, Bochenkova E, Müller A, Moroz-Omori EV, Huang D, Caflisch A.. (2021) 1,4,9-Triazaspiro[5.5]undecan-2-one Derivatives as Potent and Selective METTL3 Inhibitors., 64 (17.0): [PMID:34431664 ] [10.1021/acs.jmedchem.1c00773 ]