2-[[7-acetyl-3-(2-furylmethyl)-4-oxo-6,8-dihydro-5H-pyrido[2,3]thieno[2,4-b]pyrimidin-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide

ID: ALA5094939

PubChem CID: 50799760

Max Phase: Preclinical

Molecular Formula: C24H21ClN4O4S2

Molecular Weight: 529.04

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCc2c(sc3nc(SCC(=O)Nc4cccc(Cl)c4)n(Cc4ccco4)c(=O)c23)C1

Standard InChI:  InChI=1S/C24H21ClN4O4S2/c1-14(30)28-8-7-18-19(12-28)35-22-21(18)23(32)29(11-17-6-3-9-33-17)24(27-22)34-13-20(31)26-16-5-2-4-15(25)10-16/h2-6,9-10H,7-8,11-13H2,1H3,(H,26,31)

Standard InChI Key:  BTWFAMRPAIUCHA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -1.7416    0.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0272    1.2561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3126    0.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0272   -0.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7416    0.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5262    1.0985    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5262   -0.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0112    0.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8619   -0.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6825   -1.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1674   -0.4087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8318    0.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9927   -0.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4054   -1.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4054    0.3060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0272   -1.2192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4020    1.2562    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167    0.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8315    1.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5462    0.8436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8315    2.0816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4020   -0.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4020   -1.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0694   -1.7077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8145   -2.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0104   -2.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2653   -1.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3126    0.0185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2609    1.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2612    2.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9741    2.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6891    2.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6906    1.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9787    0.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4054    0.8457    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  1  5  2  0
  5  4  1  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  8  6  1  0
  7  9  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
  8 12  1  0
 11 13  1  0
 13 14  1  0
 13 15  2  0
  4 16  2  0
  3 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 24 23  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  2  0
 28 22  1  0
  4 28  1  0
  3 28  1  0
 20 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 29 34  1  0
 33 35  1  0
M  END

Associated Targets(Human)

BRD3 Tchem Bromodomain-containing protein 3 (1086 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.04Molecular Weight (Monoisotopic): 528.0693AlogP: 4.39#Rotatable Bonds: 6
Polar Surface Area: 97.44Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.36CX Basic pKa: 2.06CX LogP: 3.65CX LogD: 3.65
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -2.83

References

1. Carrasco K, Montersino C, Derviaux C, Saez-Ayala M, Hoffer L, Restouin A, Castellano R, Casassa J, Roche P, Pasquier E, Combes S, Morelli X, Collette Y, Betzi S..  (2022)  CRCM5484: A BET-BDII Selective Compound with Differential Anti-leukemic Drug Modulation.,  65  (7.0): [PMID:35348328] [10.1021/acs.jmedchem.1c02168]

Source