The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-((S)-2-((((4,4-difluorocyclohexyl)methoxy)carbonyl)amino)-4-methylpentanamido)-1-hydroxy-3-((S)-2-oxopyrrolidin-3-yl)propane-1-sulfonic acid ID: ALA5095608
PubChem CID: 166625508
Max Phase: Preclinical
Molecular Formula: C21H35F2N3O8S
Molecular Weight: 527.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCC1CCC(F)(F)CC1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(O)S(=O)(=O)O
Standard InChI: InChI=1S/C21H35F2N3O8S/c1-12(2)9-15(26-20(30)34-11-13-3-6-21(22,23)7-4-13)18(28)25-16(19(29)35(31,32)33)10-14-5-8-24-17(14)27/h12-16,19,29H,3-11H2,1-2H3,(H,24,27)(H,25,28)(H,26,30)(H,31,32,33)/t14-,15-,16-,19?/m0/s1
Standard InChI Key: BHZBRFONZANPNK-ZYHFAYPJSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
10.6203 -6.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0580 -8.2455 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.4746 -7.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6492 -7.5284 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.7492 -8.6705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3409 -7.9579 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.9280 -8.6678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2016 -6.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4846 -6.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2016 -5.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0504 -5.4736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0504 -6.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9229 -5.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7674 -6.7188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2016 -4.2327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4846 -5.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1996 -7.5436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9172 -6.3080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9129 -7.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9109 -8.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6285 -7.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6305 -6.7223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0573 -7.5509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1954 -9.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4419 -8.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8884 -9.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2990 -10.1859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1063 -10.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7179 -10.5699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3355 -6.7139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9066 -6.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1927 -6.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9055 -7.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1906 -7.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4777 -6.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
6 5 2 0
7 6 2 0
10 15 1 0
12 11 2 0
10 13 1 0
9 16 1 1
16 10 1 0
12 14 1 0
9 8 1 0
14 9 1 0
8 17 1 0
8 18 2 0
19 17 1 6
19 20 1 0
19 21 1 0
21 22 1 0
21 6 1 0
6 23 1 0
24 20 1 1
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
28 29 2 0
12 30 1 0
30 1 1 0
31 1 1 0
31 32 1 0
31 33 1 0
33 34 1 0
32 35 1 0
34 3 1 0
35 3 1 0
M END
Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.59Molecular Weight (Monoisotopic): 527.2113AlogP: 1.17#Rotatable Bonds: 11Polar Surface Area: 171.13Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: -1.05CX Basic pKa: ┄CX LogP: -0.67CX LogD: -1.96Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.25Np Likeness Score: 0.32