The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-beta-hydroxy-27-p-(Z)-coumaroyloxyolean-12-en-28-oic acid ID: ALA509592
PubChem CID: 44583697
Max Phase: Preclinical
Molecular Formula: C39H54O5
Molecular Weight: 602.86
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC[C@]2(C(=O)O)CC[C@]3(CC(=O)/C=C\c4ccc(O)cc4)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1
Standard InChI: InChI=1S/C39H54O5/c1-34(2)19-20-38(33(43)44)21-22-39(23-27(41)12-9-25-7-10-26(40)11-8-25)28(29(38)24-34)13-14-31-36(5)17-16-32(42)35(3,4)30(36)15-18-37(31,39)6/h7-13,29-32,40,42H,14-24H2,1-6H3,(H,43,44)/b12-9-/t29-,30-,31+,32-,36-,37+,38-,39-/m0/s1
Standard InChI Key: MJZYILIXAGAWLU-QDPBTVMJSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
-3.2142 -11.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4994 -11.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7964 -11.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8078 -10.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0990 -10.2187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3788 -10.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3300 -10.2013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3673 -11.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0762 -11.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2133 -10.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4987 -10.2410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.4886 -9.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4886 -10.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7842 -11.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7842 -9.4003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0674 -9.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0601 -10.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3450 -11.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3471 -9.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6319 -9.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6241 -8.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3463 -8.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9089 -8.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9195 -9.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2146 -9.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4948 -9.4265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1936 -8.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4874 -8.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7748 -8.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7579 -7.3823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4599 -6.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1829 -7.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1987 -9.0046 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.6398 -8.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0683 -8.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2119 -11.0631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.3678 -11.6410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1932 -11.6410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9276 -10.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6499 -10.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7785 -9.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7763 -9.8345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0631 -8.6024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7764 -10.2291 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-5.3520 -10.2250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.0487 -6.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8784 -6.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 22 1 0
23 24 1 0
10 11 2 0
12 13 1 0
2 3 1 0
3 4 1 0
23 27 1 0
24 25 1 0
25 26 1 0
26 28 1 0
27 28 1 0
4 5 2 0
5 6 1 0
12 15 1 0
13 14 1 0
14 17 1 0
16 15 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
16 17 1 0
27 33 1 1
6 7 1 0
20 34 1 1
6 8 2 0
16 35 1 1
8 9 1 0
13 36 1 1
16 19 1 0
14 37 1 0
17 18 1 0
14 38 1 0
18 40 1 0
24 39 1 6
40 20 1 0
39 10 1 0
19 20 1 0
28 41 1 1
3 9 2 0
41 42 1 0
41 43 2 0
1 10 1 0
1 2 2 0
17 44 1 6
19 22 1 0
19 45 1 6
20 24 1 0
31 46 1 0
23 21 2 0
31 47 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.86Molecular Weight (Monoisotopic): 602.3971AlogP: 8.59#Rotatable Bonds: 5Polar Surface Area: 94.83Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.58CX Basic pKa: ┄CX LogP: 8.10CX LogD: 5.35Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.23Np Likeness Score: 2.75
References 1. Lee JS, Kim J, Kim BY, Lee HS, Ahn JS, Chang YS.. (2000) Inhibition of phospholipase cgamma1 and cancer cell proliferation by triterpene esters from Uncaria rhynchophylla., 63 (6): [PMID:10869194 ] [10.1021/np990478k ]