The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(4-(3-(3-tert-Butyl-1-m-tolyl-1H-pyrazol-5-yl)ureido)phenylamino)quinazolin-6-yl)propionamide ID: ALA510516
PubChem CID: 44186427
Max Phase: Preclinical
Molecular Formula: C32H34N8O2
Molecular Weight: 562.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1ccc2ncnc(Nc3ccc(NC(=O)Nc4cc(C(C)(C)C)nn4-c4cccc(C)c4)cc3)c2c1
Standard InChI: InChI=1S/C32H34N8O2/c1-6-29(41)35-23-14-15-26-25(17-23)30(34-19-33-26)36-21-10-12-22(13-11-21)37-31(42)38-28-18-27(32(3,4)5)39-40(28)24-9-7-8-20(2)16-24/h7-19H,6H2,1-5H3,(H,35,41)(H,33,34,36)(H2,37,38,42)
Standard InChI Key: FQVDDJWQBNAYCH-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
2.6937 -5.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4797 -5.6562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9652 -6.3242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4763 -6.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6939 -6.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4929 -7.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2161 -8.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7861 -8.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2861 -7.5902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0258 -5.4238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3081 -5.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5959 -5.4126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3021 -6.6564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1222 -5.8203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8329 -5.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5505 -5.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5570 -6.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8397 -7.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1250 -6.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2746 -7.0438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2795 -7.8696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2894 -9.5160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5694 -9.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5677 -8.2792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0026 -9.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9935 -8.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6987 -7.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4136 -8.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4188 -9.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7129 -9.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8897 -4.9394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7131 -4.9377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1231 -4.2218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7073 -3.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8772 -3.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4710 -4.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9489 -4.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1254 -7.8449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1186 -7.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8229 -6.6004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4001 -6.6121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6883 -7.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 10 1 0
20 21 1 0
21 26 2 0
5 1 2 0
25 22 2 0
10 11 1 0
22 23 1 0
1 2 1 0
23 24 2 0
24 21 1 0
11 12 1 0
4 6 1 0
25 26 1 0
11 13 2 0
26 27 1 0
27 28 2 0
12 14 1 0
28 29 1 0
6 7 1 0
29 30 2 0
30 25 1 0
14 15 2 0
2 31 1 0
2 3 1 0
31 32 2 0
15 16 1 0
32 33 1 0
6 8 1 0
33 34 2 0
16 17 2 0
34 35 1 0
3 4 2 0
35 36 2 0
36 31 1 0
17 18 1 0
33 37 1 0
6 9 1 0
28 38 1 0
18 19 2 0
38 39 1 0
19 14 1 0
39 40 2 0
4 5 1 0
39 41 1 0
17 20 1 0
41 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.68Molecular Weight (Monoisotopic): 562.2805AlogP: 7.16#Rotatable Bonds: 7Polar Surface Area: 125.86Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.57CX Basic pKa: 4.20CX LogP: 7.16CX LogD: 7.16Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.17Np Likeness Score: -1.90
References 1. Getlik M, Grütter C, Simard JR, Klüter S, Rabiller M, Rode HB, Robubi A, Rauh D.. (2009) Hybrid compound design to overcome the gatekeeper T338M mutation in cSrc., 52 (13): [PMID:19462975 ] [10.1021/jm9002928 ] 2. Klüter S, Grütter C, Naqvi T, Rabiller M, Simard JR, Pawar V, Getlik M, Rauh D.. (2010) Displacement assay for the detection of stabilizers of inactive kinase conformations., 53 (1): [PMID:19928858 ] [10.1021/jm901297e ] 3. Richters A, Ketzer J, Getlik M, Grütter C, Schneider R, Heuckmann JM, Heynck S, Sos ML, Gupta A, Unger A, Schultz-Fademrecht C, Thomas RK, Bauer S, Rauh D.. (2013) Targeting gain of function and resistance mutations in Abl and KIT by hybrid compound design., 56 (14): [PMID:23773153 ] [10.1021/jm4004076 ]