5-((1-(4-chlorobenzoyl)-1H-indol-3-yl)methylene)-1,3-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione

ID: ALA511397

PubChem CID: 44574116

Max Phase: Preclinical

Molecular Formula: C22H16ClN3O4

Molecular Weight: 421.84

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1C(=O)C(=Cc2cn(C(=O)c3ccc(Cl)cc3)c3ccccc23)C(=O)N(C)C1=O

Standard InChI:  InChI=1S/C22H16ClN3O4/c1-24-20(28)17(21(29)25(2)22(24)30)11-14-12-26(18-6-4-3-5-16(14)18)19(27)13-7-9-15(23)10-8-13/h3-12H,1-2H3

Standard InChI Key:  SYQNVQVOMHJJBW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    1.9827  -15.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9815  -16.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6943  -16.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6924  -15.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4105  -15.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4110  -16.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2020  -16.6608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6904  -15.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2012  -15.3154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4554  -14.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2623  -14.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8187  -14.9739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6224  -14.8045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8810  -14.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3294  -13.4062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5194  -13.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5641  -15.7586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6884  -13.8518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9694  -12.9604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1725  -15.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5864  -12.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4573  -17.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9057  -18.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1006  -17.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5494  -18.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8045  -19.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6163  -19.4511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1641  -18.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2644  -17.6161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2537  -19.8959    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  6  7  1  0
 12 17  2  0
  7  8  1  0
 14 18  2  0
  8  9  2  0
 16 19  2  0
  9  5  1  0
 13 20  1  0
  4  1  1  0
 15 21  1  0
  9 10  1  0
  7 22  1  0
  5  6  1  0
 22 23  1  0
 10 11  2  0
 23 24  2  0
 11 12  1  0
 24 25  1  0
 25 26  2  0
  2  3  1  0
 26 27  1  0
  3  6  2  0
 27 28  2  0
 28 23  1  0
  1  2  2  0
 22 29  2  0
  5  4  2  0
 26 30  1  0
M  END

Associated Targets(Human)

RXF 393 (41971 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.84Molecular Weight (Monoisotopic): 421.0829AlogP: 3.42#Rotatable Bonds: 2
Polar Surface Area: 79.69Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.11CX LogD: 3.11
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.23

References

1. Singh P, Kaur M, Verma P..  (2009)  Design, synthesis and anticancer activities of hybrids of indole and barbituric acids--identification of highly promising leads.,  19  (11): [PMID:19398334] [10.1016/j.bmcl.2009.04.014]

Source