(3S,4R)-2-(6-Benzenesulfonyl-3-hydroxy-2,2-dimethylchroman-4-yl)-5-chloro-4-benzo[d] isoxazol-3-one

ID: ALA514789

PubChem CID: 44564388

Max Phase: Preclinical

Molecular Formula: C24H20ClNO6S

Molecular Weight: 485.95

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)Oc2ccc(S(=O)(=O)c3ccccc3)cc2[C@@H](n2oc3ccc(Cl)cc3c2=O)[C@@H]1O

Standard InChI:  InChI=1S/C24H20ClNO6S/c1-24(2)22(27)21(26-23(28)18-12-14(25)8-10-20(18)32-26)17-13-16(9-11-19(17)31-24)33(29,30)15-6-4-3-5-7-15/h3-13,21-22,27H,1-2H3/t21-,22+/m1/s1

Standard InChI Key:  OFJWJKKXIPNEFE-YADHBBJMSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   13.0028   -9.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0016  -10.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7164  -10.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7145   -9.1154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4299   -9.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4287  -10.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1455  -10.7727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8682  -10.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8694   -9.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1479   -9.1067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2749  -11.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5789   -9.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5848   -9.1158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1480   -8.2817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8138   -7.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4791   -7.7989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5982   -8.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7339   -7.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5585   -7.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9719   -6.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5617   -5.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7340   -5.5918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3244   -6.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2882   -9.1158    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.5710   -8.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7001   -8.4010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8786   -9.8318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5725   -7.8746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8560   -7.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1391   -7.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1431   -8.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8600   -9.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9750   -4.8770    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 15 19  1  0
 18 16  1  0
 16 14  1  0
  4  1  1  0
 15 17  2  0
  5 10  1  0
  6  7  1  0
 18 19  2  0
  7  8  1  0
 19 20  1  0
  8  9  1  0
 20 21  2  0
  9 10  1  0
 21 22  1  0
  5  6  1  0
 22 23  2  0
 23 18  1  0
  8 11  1  0
  1 24  1  0
 24 25  1  0
  8 12  1  0
 24 26  2  0
  2  3  1  0
 24 27  2  0
  9 13  1  6
 25 28  2  0
  3  6  2  0
 28 29  1  0
 10 14  1  1
 29 30  2  0
 14 15  1  0
 30 31  1  0
  1  2  2  0
 31 32  2  0
 32 25  1  0
  5  4  2  0
 21 33  1  0
M  END

Associated Targets(Human)

ABCC9 Tclin Sulfonylurea receptor 2 (109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.95Molecular Weight (Monoisotopic): 485.0700AlogP: 4.20#Rotatable Bonds: 3
Polar Surface Area: 98.74Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.16CX Basic pKa: CX LogP: 4.19CX LogD: 4.19
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -0.26

References

1. Zhang X, Qiu Y, Li X, Bhattacharjee S, Woods M, Kraft P, Lundeen SG, Sui Z..  (2009)  Discovery and structure-activity relationships of a novel series of benzopyran-based K(ATP) openers for urge urinary incontinence.,  17  (2): [PMID:19101153] [10.1016/j.bmc.2008.11.055]

Source