The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(2-Aminoethylamino)-3-(4-ethylbenzyl)-1-(4-methoxybenzyl)-1,3,5-triazine-2,4(1H,3H)-dione ID: ALA514895
PubChem CID: 25138121
Max Phase: Preclinical
Molecular Formula: C22H27N5O3
Molecular Weight: 409.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(Cn2c(=O)nc(NCCN)n(Cc3ccc(OC)cc3)c2=O)cc1
Standard InChI: InChI=1S/C22H27N5O3/c1-3-16-4-6-17(7-5-16)15-27-21(28)25-20(24-13-12-23)26(22(27)29)14-18-8-10-19(30-2)11-9-18/h4-11H,3,12-15,23H2,1-2H3,(H,24,25,28)
Standard InChI Key: SBCYNSAHFDNMMM-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
12.7377 1.4163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7377 0.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4522 0.1741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1713 0.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1713 1.4163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4522 1.8335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4509 2.6585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0231 0.1741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0221 1.8271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3086 1.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4509 -0.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7359 -1.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0266 -0.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3120 -1.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3105 -1.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0294 -2.2955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7410 -1.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5968 1.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8837 1.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8853 0.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6058 0.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3159 0.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1723 0.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4563 0.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5959 -2.2946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8814 -1.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8852 0.1731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6002 0.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3142 0.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0292 0.5827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14 15 2 0
1 2 1 0
15 16 1 0
2 8 2 0
16 17 2 0
17 12 1 0
1 6 1 0
10 18 2 0
1 9 1 0
18 19 1 0
2 3 1 0
19 20 2 0
9 10 1 0
20 21 1 0
3 4 1 0
21 22 2 0
22 10 1 0
3 11 1 0
20 23 1 0
4 5 2 0
23 24 1 0
11 12 1 0
15 25 1 0
5 6 1 0
25 26 1 0
12 13 2 0
4 27 1 0
27 28 1 0
13 14 1 0
28 29 1 0
6 7 2 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.49Molecular Weight (Monoisotopic): 409.2114AlogP: 1.44#Rotatable Bonds: 9Polar Surface Area: 104.17Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.06CX LogP: 2.76CX LogD: 2.01Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.55Np Likeness Score: -0.92
References 1. Balboni G, Lazzari I, Trapella C, Negri L, Lattanzi R, Giannini E, Nicotra A, Melchiorri P, Visentin S, Nuccio CD, Salvadori S.. (2008) Triazine compounds as antagonists at Bv8-prokineticin receptors., 51 (23): [PMID:19006379 ] [10.1021/jm800854e ]