The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
episteganangin ID: ALA514914
PubChem CID: 38353779
Max Phase: Preclinical
Molecular Formula: C27H28O9
Molecular Weight: 496.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Episteganangin | episteganangin|CHEMBL514914
Canonical SMILES: C/C=C(/C)C(=O)O[C@@H]1c2cc3c(cc2-c2c(cc(OC)c(OC)c2OC)C[C@H]2C(=O)OC[C@H]12)OCO3
Standard InChI: InChI=1S/C27H28O9/c1-6-13(2)26(28)36-23-16-10-20-19(34-12-35-20)9-15(16)22-14(7-17-18(23)11-33-27(17)29)8-21(30-3)24(31-4)25(22)32-5/h6,8-10,17-18,23H,7,11-12H2,1-5H3/b13-6-/t17-,18+,23-/m1/s1
Standard InChI Key: IIEOCQLKEFBZIS-ZUEJIALFSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
4.9029 -2.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8996 -0.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1901 -1.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1925 -0.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4098 -0.7123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9188 -1.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4061 -2.0479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6144 -1.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1976 -0.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6164 -0.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6196 -1.7950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0257 -0.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6099 -0.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3453 -0.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2163 0.2233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4051 0.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0749 -0.9670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0333 -2.3729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2045 -2.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7945 -3.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2112 -3.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0406 -3.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4445 -3.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7790 0.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1853 1.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7706 1.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0062 1.0522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1723 2.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9452 1.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9979 2.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9735 -3.0937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5611 -3.8058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8010 -4.5195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9801 -4.5251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4540 -4.5134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0463 -5.2237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1919 -1.5443 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.6137 0.3353 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3 1 1 0
1 11 2 0
10 2 2 0
2 4 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 3 1 0
13 8 1 0
8 18 1 0
12 9 1 0
9 10 1 0
10 11 1 0
11 19 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
12 16 1 0
14 17 2 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
9 24 1 1
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
26 29 1 0
28 30 1 0
20 31 1 0
31 32 1 0
21 33 1 0
33 34 1 0
22 35 1 0
35 36 1 0
13 37 1 1
12 38 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.51Molecular Weight (Monoisotopic): 496.1733AlogP: 4.00#Rotatable Bonds: 5Polar Surface Area: 98.75Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.06CX LogD: 4.06Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: 1.97
References 1. Wickramaratne DB, Pengsuparp T, Mar W, Chai HB, Chagwedera TE, Beecher CW, Farnsworth NR, Kinghorn AD, Pezzuto JM, Cordell GA.. (1993) Novel antimitotic dibenzocyclo-octadiene lignan constituents of the stem bark of Steganotaenia araliacea., 56 (12): [PMID:8133298 ] [10.1021/np50102a009 ]