The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((1R,2R)-1-cyano-2-phenylcyclopropylamino)-3-(3-fluorothiophen-2-yl)-1-oxopropan-2-aminium 2,2,2-trifluoroacetate ID: ALA515494
PubChem CID: 49797571
Max Phase: Preclinical
Molecular Formula: C19H17F4N3O3S
Molecular Weight: 329.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#C[C@@]1(NC(=O)C(N)Cc2sccc2F)C[C@@H]1c1ccccc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C17H16FN3OS.C2HF3O2/c18-13-6-7-23-15(13)8-14(20)16(22)21-17(10-19)9-12(17)11-4-2-1-3-5-11;3-2(4,5)1(6)7/h1-7,12,14H,8-9,20H2,(H,21,22);(H,6,7)/t12-,14?,17+;/m1./s1
Standard InChI Key: FVCXUKFQJFQVFK-VVARSMMGSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
3.0625 -11.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0625 -11.8536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7783 -10.6161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3466 -10.6161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 -11.8536 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.0625 -12.6786 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2375 -11.8536 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.7213 -14.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9074 -14.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7859 -13.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5280 -13.5967 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.1038 -14.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0536 -13.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3563 -14.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6282 -13.6439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3914 -14.8485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0691 -14.0845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5930 -12.8191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8014 -13.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6229 -13.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2430 -13.0052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3207 -14.1775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2849 -15.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9818 -15.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7147 -15.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7462 -14.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0487 -13.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6567 -12.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5152 -12.0770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3209 -15.3587 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
2 5 1 0
2 6 1 0
2 7 1 0
8 9 1 0
17 19 1 0
20 19 1 0
21 20 1 0
19 21 1 0
10 13 1 0
13 14 1 0
20 22 1 6
9 10 2 0
22 23 2 0
14 15 1 0
23 24 1 0
10 11 1 0
24 25 2 0
14 16 1 0
25 26 1 0
11 12 1 0
26 27 2 0
27 22 1 0
15 17 1 0
19 28 1 1
12 8 2 0
28 29 3 0
15 18 2 0
9 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 329.40Molecular Weight (Monoisotopic): 329.0998AlogP: 2.32#Rotatable Bonds: 5Polar Surface Area: 78.91Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.27CX Basic pKa: 7.74CX LogP: 2.28CX LogD: 1.77Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.88Np Likeness Score: -0.54
References 1. Méthot N, Rubin J, Guay D, Beaulieu C, Ethier D, Reddy TJ, Riendeau D, Percival MD.. (2007) Inhibition of the activation of multiple serine proteases with a cathepsin C inhibitor requires sustained exposure to prevent pro-enzyme processing., 282 (29): [PMID:17535802 ] [10.1074/jbc.m702615200 ]