11-((2R,8R,10S,11S)-2,8-Dihydroxy-7-oxo-11-pentyl-9-oxa-4-aza-tricyclo[6.3.1.0*1,5*]dodec-5-en-10-yl)-10-oxo-undecanoic acid

ID: ALA515684

PubChem CID: 44588273

Max Phase: Preclinical

Molecular Formula: C26H41NO7

Molecular Weight: 479.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCC[C@@H]1[C@H](CC(=O)CCCCCCCCC(=O)O)O[C@]2(O)CC13C(=CC2=O)NC[C@@H]3O

Standard InChI:  InChI=1S/C26H41NO7/c1-2-3-8-12-19-20(14-18(28)11-9-6-4-5-7-10-13-24(31)32)34-26(33)17-25(19)21(15-22(26)29)27-16-23(25)30/h15,19-20,23,27,30,33H,2-14,16-17H2,1H3,(H,31,32)/t19-,20+,23+,25?,26-/m1/s1

Standard InChI Key:  VMUKONOXODRWTD-FSJJMVLZSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   -2.1463   -8.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4343   -8.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4343   -7.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1463   -6.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8625   -6.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4417   -6.4667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1598   -6.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6125   -7.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5781   -6.0561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5804   -5.2311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1637   -5.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4511   -4.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4550   -3.9947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7347   -5.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0222   -4.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6942   -5.2222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4067   -4.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1231   -5.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8357   -4.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5521   -5.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2646   -4.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9810   -5.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9863   -6.0283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6950   -4.7874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8583   -8.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8583   -7.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6473   -7.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1350   -7.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6473   -8.3729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7204   -8.5302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3667   -6.6167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2959   -4.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2982   -3.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0138   -3.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
  6  7  1  0
 16 17  1  0
  1  2  1  0
 17 18  1  0
  3  8  1  6
 18 19  1  0
  2  3  1  0
 19 20  1  0
  5  9  1  6
 20 21  1  0
  3  4  1  0
 21 22  1  0
  9 10  1  0
 22 23  1  0
 22 24  2  0
 25 26  1  0
  7 11  1  6
 26  5  1  0
 11 12  1  0
 26  4  1  0
 12 13  2  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
  3  6  1  0
  2 30  2  0
 12 14  1  0
 27 31  1  6
  5  7  1  0
 10 32  1  0
 14 15  1  0
 32 33  1  0
 25  1  2  0
 33 34  1  0
M  END

Associated Targets(non-human)

Lemna aequinoctialis (120 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.61Molecular Weight (Monoisotopic): 479.2883AlogP: 3.24#Rotatable Bonds: 15
Polar Surface Area: 133.16Molecular Species: ACIDHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 5.02CX Basic pKa: CX LogP: 3.58CX LogD: 1.23
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: 1.46

References

1. Kai K, Takeuchi J, Kataoka T, Yokoyama M, Watanabe N..  (2008)  Structure and biological activity of novel FN analogs as flowering inducers.,  16  (23): [PMID:18952445] [10.1016/j.bmc.2008.10.014]

Source