The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-((2R,8R,10S,11S)-2,8-Dihydroxy-7-oxo-11-pentyl-9-oxa-4-aza-tricyclo[6.3.1.0*1,5*]dodec-5-en-10-yl)-10-oxo-undecanoic acid ID: ALA515684
PubChem CID: 44588273
Max Phase: Preclinical
Molecular Formula: C26H41NO7
Molecular Weight: 479.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC[C@@H]1[C@H](CC(=O)CCCCCCCCC(=O)O)O[C@]2(O)CC13C(=CC2=O)NC[C@@H]3O
Standard InChI: InChI=1S/C26H41NO7/c1-2-3-8-12-19-20(14-18(28)11-9-6-4-5-7-10-13-24(31)32)34-26(33)17-25(19)21(15-22(26)29)27-16-23(25)30/h15,19-20,23,27,30,33H,2-14,16-17H2,1H3,(H,31,32)/t19-,20+,23+,25?,26-/m1/s1
Standard InChI Key: VMUKONOXODRWTD-FSJJMVLZSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
-2.1463 -8.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4343 -8.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4343 -7.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1463 -6.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8625 -6.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4417 -6.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1598 -6.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6125 -7.2917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5781 -6.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5804 -5.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1637 -5.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4511 -4.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4550 -3.9947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7347 -5.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0222 -4.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6942 -5.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4067 -4.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1231 -5.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8357 -4.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5521 -5.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2646 -4.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9810 -5.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9863 -6.0283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6950 -4.7874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8583 -8.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8583 -7.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6473 -7.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1350 -7.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6473 -8.3729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7204 -8.5302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3667 -6.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2959 -4.8206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2982 -3.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0138 -3.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
6 7 1 0
16 17 1 0
1 2 1 0
17 18 1 0
3 8 1 6
18 19 1 0
2 3 1 0
19 20 1 0
5 9 1 6
20 21 1 0
3 4 1 0
21 22 1 0
9 10 1 0
22 23 1 0
22 24 2 0
25 26 1 0
7 11 1 6
26 5 1 0
11 12 1 0
26 4 1 0
12 13 2 0
26 27 1 0
27 28 1 0
28 29 1 0
29 25 1 0
3 6 1 0
2 30 2 0
12 14 1 0
27 31 1 6
5 7 1 0
10 32 1 0
14 15 1 0
32 33 1 0
25 1 2 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.61Molecular Weight (Monoisotopic): 479.2883AlogP: 3.24#Rotatable Bonds: 15Polar Surface Area: 133.16Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.02CX Basic pKa: ┄CX LogP: 3.58CX LogD: 1.23Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: 1.46
References 1. Kai K, Takeuchi J, Kataoka T, Yokoyama M, Watanabe N.. (2008) Structure and biological activity of novel FN analogs as flowering inducers., 16 (23): [PMID:18952445 ] [10.1016/j.bmc.2008.10.014 ]