N-benzyl-2-(7-([18F]-2-fluoroethyl)-8-oxo-2-phenyl-7H-purin-9(8H)-yl)-N-methylacetamide

ID: ALA516108

PubChem CID: 25256784

Max Phase: Preclinical

Molecular Formula: C23H22FN5O2

Molecular Weight: 419.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(Cc1ccccc1)C(=O)Cn1c(=O)n(CC[18F])c2cnc(-c3ccccc3)nc21

Standard InChI:  InChI=1S/C23H22FN5O2/c1-27(15-17-8-4-2-5-9-17)20(30)16-29-22-19(28(13-12-24)23(29)31)14-25-21(26-22)18-10-6-3-7-11-18/h2-11,14H,12-13,15-16H2,1H3/i24-1

Standard InChI Key:  QJZDLHWHIBNCJV-MIGPCILRSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    6.3775  -18.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0906  -19.0113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8100  -18.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8068  -17.7667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3789  -17.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0907  -17.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9174  -16.5522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0982  -16.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7655  -17.2214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6837  -15.7550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4677  -15.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2753  -16.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8256  -15.4923    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5324  -16.8908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6331  -15.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1835  -15.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9886  -15.2174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5388  -14.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2819  -13.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4696  -13.6510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9230  -14.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5240  -19.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5235  -19.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2375  -20.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9527  -19.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9493  -19.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2345  -18.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5686  -14.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9590  -17.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4052  -16.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5987  -16.9574    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 13 15  1  0
  3  4  1  0
 15 16  1  0
  6  7  1  0
 16 17  2  0
  7  8  1  0
 17 18  1  0
  8  9  1  0
 18 19  2  0
  9  5  1  0
 19 20  1  0
  4  6  2  0
 20 21  2  0
 21 16  1  0
  8 10  2  0
  5  6  1  0
 22 23  2  0
  7 11  1  0
 23 24  1  0
  1  2  1  0
 24 25  2  0
 11 12  1  0
 25 26  1  0
  5  1  2  0
 26 27  2  0
 27 22  1  0
  3 22  1  0
 12 13  1  0
 13 28  1  0
  2  3  2  0
  9 29  1  0
 12 14  2  0
 29 30  1  0
 30 31  1  0
M  ISO  1  31  18
M  END

Associated Targets(non-human)

Striatum (335 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.46Molecular Weight (Monoisotopic): 419.1758AlogP: 2.89#Rotatable Bonds: 7
Polar Surface Area: 73.02Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.40CX LogP: 3.92CX LogD: 3.92
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -1.68

References

1. Yanamoto K, Kumata K, Yamasaki T, Odawara C, Kawamura K, Yui J, Hatori A, Suzuki K, Zhang MR..  (2009)  [18F]FEAC and [18F]FEDAC: Two novel positron emission tomography ligands for peripheral-type benzodiazepine receptor in the brain.,  19  (6): [PMID:19217778] [10.1016/j.bmcl.2009.01.093]

Source