The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
kalmitoxin V ID: ALA516529
PubChem CID: 44584060
Max Phase: Preclinical
Molecular Formula: C24H36O9
Molecular Weight: 468.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Kalmitoxin V | kalmitoxin V|CHEMBL516529|NS00093903
Canonical SMILES: CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@]2(O)[C@@H]([C@@H]3O[C@@H]3C2(C)C)[C@](C)(O)[C@@H]2CC[C@@H]3[C@@H](O)[C@]12C[C@@]3(C)O
Standard InChI: InChI=1S/C24H36O9/c1-10(25)31-18-19(32-11(2)26)24(30)15(14-17(33-14)20(24,3)4)22(6,29)13-8-7-12-16(27)23(13,18)9-21(12,5)28/h12-19,27-30H,7-9H2,1-6H3/t12-,13+,14+,15+,16-,17+,18-,19-,21-,22-,23-,24+/m1/s1
Standard InChI Key: UNNXYQQFBSBBGT-DVYZUMFWSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
6.8215 1.3638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3949 -0.4370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2218 -0.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8849 0.2133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0791 1.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0574 0.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5645 0.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7421 0.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5183 -0.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1254 0.4990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9520 1.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1696 1.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9540 -0.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3374 -0.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1313 -0.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2273 2.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2597 -0.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0514 -0.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0746 1.8447 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.5645 1.8189 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.8421 0.9092 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.7413 0.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3775 1.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5976 1.7364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2147 -1.2810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0225 -1.1929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9370 -1.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9300 -2.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6706 -1.2920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4895 -1.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1213 -2.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3288 -1.8354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1556 0.3335 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3775 2.2772 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.7265 -0.8525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3317 -1.1295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4028 2.0822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4680 -0.4949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8 3 1 0
2 3 1 0
4 5 1 0
5 23 1 0
22 6 1 0
6 4 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
8 13 1 1
10 14 1 0
13 14 1 0
14 15 1 1
1 16 1 1
6 17 1 0
6 18 1 0
5 19 1 6
7 20 1 1
10 21 1 6
23 22 1 0
23 24 1 0
22 24 1 0
3 25 1 6
2 26 1 1
25 27 1 0
27 28 1 0
27 29 2 0
26 30 1 0
30 31 1 0
30 32 2 0
22 33 1 6
23 34 1 6
5 1 1 0
1 7 1 0
4 2 1 0
14 36 1 0
9 35 1 1
1 37 1 0
4 38 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.54Molecular Weight (Monoisotopic): 468.2359AlogP: 0.30#Rotatable Bonds: 2Polar Surface Area: 146.05Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.92CX Basic pKa: ┄CX LogP: -0.90CX LogD: -0.90Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: 3.00
References 1. El-Naggar SF, Doskotch RW, ODell TM, Girard L. (1980) Antifeedant Diterpenes For the Gypsy Moth Larvae From Kalmia latifolia: Isolation and Characterization of Ten Grayanoids, 43 (5): [10.1021/np50011a016 ]