The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
serratamolide D ID: ALA516546
PubChem CID: 24862374
Max Phase: Preclinical
Molecular Formula: C27H48N2O8
Molecular Weight: 528.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Serratamolide D | CHEMBL516546
Canonical SMILES: CCCCCCCC[C@@H]1CC(=O)N[C@@H](CO)C(=O)O[C@H](CCCCCCC)CC(=O)N[C@@H](CO)C(=O)O1
Standard InChI: InChI=1S/C27H48N2O8/c1-3-5-7-9-11-13-15-21-17-25(33)29-22(18-30)26(34)36-20(14-12-10-8-6-4-2)16-24(32)28-23(19-31)27(35)37-21/h20-23,30-31H,3-19H2,1-2H3,(H,28,32)(H,29,33)/t20-,21-,22+,23+/m1/s1
Standard InChI Key: QDXNTPHOGIOVCV-LUKWVAJMSA-N
Molfile:
RDKit 2D
37 37 0 0 0 0 0 0 0 0999 V2000
11.0126 -4.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3268 -4.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7278 -4.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4690 -5.3554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6527 -5.2889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7231 -5.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4279 -5.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7659 -6.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4671 -6.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5448 -6.8396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7245 -6.7760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4761 -7.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8744 -7.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1968 -8.0643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1015 -7.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5643 -4.2284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0964 -5.1029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6393 -7.8908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0124 -5.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2943 -5.7070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1775 -6.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8959 -6.4247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7458 -8.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4605 -4.0932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1552 -4.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8879 -4.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5825 -4.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3152 -4.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0099 -4.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0484 -7.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3180 -7.9794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6206 -7.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8903 -7.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7426 -4.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4373 -4.7357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1929 -7.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4626 -7.8655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
13 18 2 0
3 5 1 0
6 19 1 6
4 6 1 0
19 20 1 0
5 7 1 0
9 21 1 6
6 8 1 0
21 22 1 0
7 9 1 0
12 23 1 1
8 10 1 0
3 24 1 1
9 11 1 0
24 25 1 0
12 10 1 0
25 26 1 0
11 13 1 0
26 27 1 0
12 14 1 0
27 28 1 0
13 14 1 0
28 29 1 0
23 30 1 0
8 15 2 0
30 31 1 0
1 2 1 0
31 32 1 0
2 16 2 0
32 33 1 0
1 3 1 0
33 36 1 0
7 17 2 0
29 34 1 0
34 35 1 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.69Molecular Weight (Monoisotopic): 528.3411AlogP: 2.67#Rotatable Bonds: 15Polar Surface Area: 151.26Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.55CX Basic pKa: ┄CX LogP: 3.32CX LogD: 3.32Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.19Np Likeness Score: 1.07
References 1. Dwivedi D, Jansen R, Molinari G, Nimtz M, Johri BN, Wray V.. (2008) Antimycobacterial serratamolides and diacyl peptoglucosamine derivatives from Serratia sp., 71 (4): [PMID:18303848 ] [10.1021/np7007126 ]