The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Vilmorrianone ID: ALA516691
PubChem CID: 44566629
Max Phase: Preclinical
Molecular Formula: C23H27NO5
Molecular Weight: 397.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Vilmorrianone | Vilmorrianone|CHEBI:66358|CHEMBL516691|Q27134905
Canonical SMILES: C=C1C[C@@]23C(=O)C(=O)[C@@H]4[C@@]5(C)C[C@H](OC(C)=O)C[C@@]46[C@@H]2C[C@@H]1C(=O)[C@@H]3[C@H]6N(C)C5
Standard InChI: InChI=1S/C23H27NO5/c1-10-6-22-14-5-13(10)16(26)15(22)19-23(14)8-12(29-11(2)25)7-21(3,9-24(19)4)18(23)17(27)20(22)28/h12-15,18-19H,1,5-9H2,2-4H3/t12-,13-,14+,15+,18+,19+,21-,22+,23+/m0/s1
Standard InChI Key: MCKIOPXSFPCTTR-NGELOBKFSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
5.2047 -14.5271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8844 -14.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8844 -14.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5944 -15.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5944 -13.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3043 -14.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3032 -14.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0123 -15.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7256 -14.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0148 -13.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7313 -14.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4477 -13.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4577 -12.9361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7456 -12.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0235 -12.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0121 -14.5680 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2946 -15.8032 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.9972 -16.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2968 -13.3350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8754 -15.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5071 -13.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1575 -11.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7565 -11.2050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3314 -11.9272 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.1800 -12.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0048 -16.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4357 -15.4020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3781 -14.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1686 -13.7494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1647 -12.9230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4532 -12.5153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8766 -12.5086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3058 -13.1539 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2903 -12.4465 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 5 1 0
3 4 1 0
4 7 1 0
6 5 1 1
6 7 1 0
6 10 1 0
7 8 1 0
8 9 1 0
9 11 1 0
10 11 1 0
10 15 1 0
11 12 1 1
12 13 1 0
13 14 1 0
14 15 1 0
10 16 1 1
7 17 1 1
4 18 1 1
6 19 1 0
4 20 1 0
11 21 1 0
19 21 1 0
14 22 1 0
22 21 1 0
22 23 2 0
14 24 1 1
13 25 2 0
8 26 2 0
9 27 2 0
1 20 1 0
19 1 1 0
1 28 1 0
2 29 1 6
29 30 1 0
30 31 1 0
30 32 2 0
21 33 1 6
19 34 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 397.47Molecular Weight (Monoisotopic): 397.1889AlogP: 1.57#Rotatable Bonds: 1Polar Surface Area: 80.75Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.95CX LogP: 1.69CX LogD: 1.03Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.38Np Likeness Score: 3.09
References 1. Atta-ur-Rahman, Nasreen A, Akhtar F, Shekhani MS, Clardy J, Parvez M, Choudhary MI.. (1997) Antifungal diterpenoid alkaloids from Delphinium denudatum., 60 (5): [PMID:9170290 ] [10.1021/np960663n ]