The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-([1,1'-biphenyl]-2-yl)-2-((4-methoxy-N-(p-tolyl)phenyl)sulfonamido)acetamide ID: ALA5169358
PubChem CID: 1319386
Max Phase: Preclinical
Molecular Formula: C28H26N2O4S
Molecular Weight: 486.59
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2-c2ccccc2)c2ccc(C)cc2)cc1
Standard InChI: InChI=1S/C28H26N2O4S/c1-21-12-14-23(15-13-21)30(35(32,33)25-18-16-24(34-2)17-19-25)20-28(31)29-27-11-7-6-10-26(27)22-8-4-3-5-9-22/h3-19H,20H2,1-2H3,(H,29,31)
Standard InChI Key: QOWYRAFWHFHPNL-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-0.3594 -0.2060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3549 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3594 -1.0313 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0742 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0742 -1.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0538 -1.7474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4664 -1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0696 -0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7845 0.2065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0696 -1.0314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4993 -0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2142 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9265 -0.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9265 -1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2159 -1.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4993 -1.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2142 1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4995 1.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5003 2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2153 2.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9273 2.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9321 1.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7892 -0.2058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5014 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5014 1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7910 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0742 1.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0744 -2.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7875 -2.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5024 -2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5040 -1.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7921 -1.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2162 1.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2172 -2.6800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9321 -2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
3 5 1 0
3 6 2 0
3 7 2 0
2 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
17 12 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
23 4 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
4 27 1 0
28 5 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
5 32 1 0
25 33 1 0
30 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.59Molecular Weight (Monoisotopic): 486.1613AlogP: 5.50#Rotatable Bonds: 8Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.91CX Basic pKa: ┄CX LogP: 5.60CX LogD: 5.60Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.55
References 1. Morales-Tenorio M, Ginex T, Cuesta-Geijo MÁ, Campillo NE, Muñoz-Fontela C, Alonso C, Delgado R, Gil C.. (2021) Potential pharmacological strategies targeting the Niemann-Pick C1 receptor and Ebola virus glycoprotein interaction., 223 [PMID:34175537 ] [10.1016/j.ejmech.2021.113654 ]