N-([1,1'-biphenyl]-2-yl)-2-((4-methoxy-N-(p-tolyl)phenyl)sulfonamido)acetamide

ID: ALA5169358

PubChem CID: 1319386

Max Phase: Preclinical

Molecular Formula: C28H26N2O4S

Molecular Weight: 486.59

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2-c2ccccc2)c2ccc(C)cc2)cc1

Standard InChI:  InChI=1S/C28H26N2O4S/c1-21-12-14-23(15-13-21)30(35(32,33)25-18-16-24(34-2)17-19-25)20-28(31)29-27-11-7-6-10-26(27)22-8-4-3-5-9-22/h3-19H,20H2,1-2H3,(H,29,31)

Standard InChI Key:  QOWYRAFWHFHPNL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -0.3594   -0.2060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3549    0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3594   -1.0313    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0742    0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0742   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0538   -1.7474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4664   -1.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0696   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845    0.2065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0696   -1.0314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4993   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2142    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9265   -0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9265   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2159   -1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4993   -1.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2142    1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4995    1.4445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5003    2.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2153    2.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9273    2.2710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9321    1.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7892   -0.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5014    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5014    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7910    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0742    1.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0744   -2.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7875   -2.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5024   -2.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5040   -1.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7921   -1.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2162    1.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2172   -2.6800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9321   -2.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  1  0
  3  5  1  0
  3  6  2  0
  3  7  2  0
  2  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 17 12  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 23  4  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
  4 27  1  0
 28  5  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
  5 32  1  0
 25 33  1  0
 30 34  1  0
 34 35  1  0
M  END

Associated Targets(non-human)

Ebolavirus (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Zaire ebolavirus (77 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.59Molecular Weight (Monoisotopic): 486.1613AlogP: 5.50#Rotatable Bonds: 8
Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.91CX Basic pKa: CX LogP: 5.60CX LogD: 5.60
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.55

References

1. Morales-Tenorio M, Ginex T, Cuesta-Geijo MÁ, Campillo NE, Muñoz-Fontela C, Alonso C, Delgado R, Gil C..  (2021)  Potential pharmacological strategies targeting the Niemann-Pick C1 receptor and Ebola virus glycoprotein interaction.,  223  [PMID:34175537] [10.1016/j.ejmech.2021.113654]

Source