(4S,7S,10S,13S)-4-((S)-sec-butyl)-15,15-difluoro-7-((R)-1-hydroxyethyl)-10,13-dimethyl-2,5,8,11,14-pentaoxo-3,6,9,12-tetraazahexadecan-16-oic acid

ID: ALA5169486

PubChem CID: 168269338

Max Phase: Preclinical

Molecular Formula: C20H32F2N4O8

Molecular Weight: 494.49

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)C(F)(F)C(=O)O)[C@@H](C)O

Standard InChI:  InChI=1S/C20H32F2N4O8/c1-7-8(2)13(25-12(6)28)17(31)26-14(11(5)27)18(32)24-10(4)16(30)23-9(3)15(29)20(21,22)19(33)34/h8-11,13-14,27H,7H2,1-6H3,(H,23,30)(H,24,32)(H,25,28)(H,26,31)(H,33,34)/t8-,9-,10-,11+,13-,14-/m0/s1

Standard InChI Key:  GLDQOOBXAXPGIW-YQGUXNGLSA-N

Molfile:  

 
     RDKit          2D

 34 33  0  0  0  0  0  0  0  0999 V2000
   -3.5735    0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8590    0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8590    1.4442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1443    0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4295    0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0001    0.6189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7146    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4293    0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4293    1.4442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8588    0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5735    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2882    0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0030    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5735   -0.6190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8588    1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7146   -0.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148   -0.6190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4295    1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1443    1.8568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148    1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5735   -0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8588   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2882   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2882   -1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2882    0.6190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0030    0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7177    0.6190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0030   -0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7177    0.6189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0030   -0.6190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7017    1.3349    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8764    1.3349    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  1
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  2  0
 12 17  1  1
  8 18  1  6
  6 19  2  0
  5 20  1  0
 20 21  1  6
 20 22  1  0
  1 23  1  0
 23 24  1  1
 23 25  1  0
 25 26  1  0
  1 27  1  6
 27 28  1  0
 28 29  2  0
 28 30  1  0
 15 31  2  0
 15 32  1  0
 14 33  1  0
 14 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5169486

    ---

Associated Targets(non-human)

SUB1 Subtilisin-like protease (110 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.49Molecular Weight (Monoisotopic): 494.2188AlogP: -1.30#Rotatable Bonds: 13
Polar Surface Area: 191.00Molecular Species: ACIDHBA: 7HBD: 6
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 2.88CX Basic pKa: 2.88CX LogP: -0.68CX LogD: -4.17
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.17Np Likeness Score: 0.07

References

1. Lidumniece E, Withers-Martinez C, Hackett F, Blackman MJ, Jirgensons A..  (2022)  Subtilisin-like Serine Protease 1 (SUB1) as an Emerging Antimalarial Drug Target: Current Achievements in Inhibitor Discovery.,  65  (19.0): [PMID:36137276] [10.1021/acs.jmedchem.2c01093]

Source