3-(4-Aminobenzyl)-6-((R)-3-hydroxypyrrolidin-1-yl)isobenzofuran-1(3H)-one

ID: ALA5169488

PubChem CID: 168269340

Max Phase: Preclinical

Molecular Formula: C19H20N2O3

Molecular Weight: 324.38

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ccc(CC2OC(=O)c3cc(N4CC[C@@H](O)C4)ccc32)cc1

Standard InChI:  InChI=1S/C19H20N2O3/c20-13-3-1-12(2-4-13)9-18-16-6-5-14(10-17(16)19(23)24-18)21-8-7-15(22)11-21/h1-6,10,15,18,22H,7-9,11,20H2/t15-,18?/m1/s1

Standard InChI Key:  VMCCHQZHAUPELO-NNJIEVJOSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   -1.4278    0.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7134    0.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0010    0.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0010   -0.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7857   -1.0488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2706   -0.3813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7857    0.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0406    1.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8476    1.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1025    2.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9095    2.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4616    1.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2686    1.7568    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2067    0.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3997    0.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0406   -1.8335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7134   -1.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4278   -0.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1423   -1.2063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2286   -2.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0356   -2.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4481   -1.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2686   -1.3977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8960   -0.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  4  5  1  0
  6  5  1  0
  3  7  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 12 13  1  0
 14 12  1  0
 15 14  2  0
  9 15  1  0
  5 16  2  0
 17  4  1  0
 18 17  2  0
  1 18  1  0
 19 18  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  1
 22 24  1  0
 24 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5169488

    ---

Associated Targets(non-human)

Maob Monoamine oxidase B (2209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 324.38Molecular Weight (Monoisotopic): 324.1474AlogP: 2.29#Rotatable Bonds: 3
Polar Surface Area: 75.79Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.17CX LogP: 2.14CX LogD: 2.14
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.67Np Likeness Score: 0.26

References

1. Liu K, Zhou S, Zhou J, Bo R, Wang X, Xu T, Yuan Y, Xu B..  (2022)  Discovery of 3, 6-disubstituted isobenzofuran-1(3H)-ones as novel inhibitors of monoamine oxidases.,  67  [PMID:35472505] [10.1016/j.bmcl.2022.128748]

Source