The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{8-[N'(cyclopropylmethyl)carbamimidamido]octyl}urea trifluoroacetate salt ID: ALA5169490
PubChem CID: 168269342
Max Phase: Preclinical
Molecular Formula: C16H30F3N5O3
Molecular Weight: 283.42
Associated Items:
Names and Identifiers Canonical SMILES: N=C(NCCCCCCCCNC(N)=O)NCC1CC1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C14H29N5O.C2HF3O2/c15-13(19-11-12-7-8-12)17-9-5-3-1-2-4-6-10-18-14(16)20;3-2(4,5)1(6)7/h12H,1-11H2,(H3,15,17,19)(H3,16,18,20);(H,6,7)
Standard InChI Key: HOQILIUACAURFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 26 0 0 0 0 0 0 0 0999 V2000
1.6363 -0.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9218 -0.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6363 0.4562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3508 -0.7812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2074 -0.3687 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9218 -1.6062 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.2544 -1.2661 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6147 1.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6147 0.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0245 -0.3872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1925 0.7742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8158 2.9765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9438 0.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9001 2.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1856 1.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4712 2.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7566 1.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0421 2.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3275 1.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6131 2.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1013 1.7388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8158 2.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5303 1.7388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2448 2.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9592 1.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3726 1.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7843 1.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 2 0
1 4 1 0
2 5 1 0
2 6 1 0
2 7 1 0
9 8 1 0
13 10 1 0
13 9 1 0
13 11 2 0
8 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 12 2 0
22 23 1 0
23 24 1 0
24 25 1 0
26 25 1 0
26 27 1 0
25 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 283.42Molecular Weight (Monoisotopic): 283.2372AlogP: 1.52#Rotatable Bonds: 11Polar Surface Area: 103.03Molecular Species: BASEHBA: 2HBD: 5#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 12.58CX LogP: 1.14CX LogD: -1.27Aromatic Rings: ┄Heavy Atoms: 20QED Weighted: 0.23Np Likeness Score: -0.13
References 1. D'Agostino I, Ardino C, Poli G, Sannio F, Lucidi M, Poggialini F, Visaggio D, Rango E, Filippi S, Petricci E, Visca P, Botta L, Docquier JD, Dreassi E.. (2022) Antibacterial alkylguanidino ureas: Molecular simplification approach, searching for membrane-based MoA., 231 [PMID:35168113 ] [10.1016/j.ejmech.2022.114158 ]