N-[(1R,3R)-3-(4-acetylpiperazin-1-yl)cyclohexyl]-4-fluoro-7-methyl-1H-indole-2-carboxamide

ID: ALA5169569

PubChem CID: 164885958

Max Phase: Preclinical

Molecular Formula: C22H29FN4O2

Molecular Weight: 400.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCN([C@@H]2CCC[C@@H](NC(=O)c3cc4c(F)ccc(C)c4[nH]3)C2)CC1

Standard InChI:  InChI=1S/C22H29FN4O2/c1-14-6-7-19(23)18-13-20(25-21(14)18)22(29)24-16-4-3-5-17(12-16)27-10-8-26(9-11-27)15(2)28/h6-7,13,16-17,25H,3-5,8-12H2,1-2H3,(H,24,29)/t16-,17-/m1/s1

Standard InChI Key:  PGNLXEBQMQHFNK-IAGOWNOFSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -4.2362   -1.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5216   -0.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8097   -1.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8097   -2.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5198   -2.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2362   -2.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0250   -2.3439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0250   -1.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5400   -1.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5216   -0.0267    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5198   -3.3259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -1.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3022   -0.9618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3022   -2.3911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5229   -0.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9355   -0.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7607   -0.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1733   -0.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7607   -1.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9355   -1.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1733    0.4674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7607    1.1820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1733    1.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9985    1.8966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4111    1.1820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9985    0.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4111    2.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9985    3.3259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2362    2.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  2 10  1  0
  5 11  1  0
  9 12  1  0
 12 13  1  0
 12 14  2  0
 15 13  1  1
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 15 20  1  0
 17 21  1  6
 22 21  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 21 26  1  0
 24 27  1  0
 27 28  2  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5169569

    ---

Associated Targets(Human)

SETD2 Tchem Histone-lysine N-methyltransferase SETD2 (119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.50Molecular Weight (Monoisotopic): 400.2275AlogP: 2.82#Rotatable Bonds: 3
Polar Surface Area: 68.44Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.76CX LogP: 1.84CX LogD: 1.33
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.83Np Likeness Score: -1.27

References

1. Alford JS, Lampe JW, Brach D, Chesworth R, Cosmopoulos K, Duncan KW, Eckley ST, Kutok JL, Raimondi A, Riera TV, Shook B, Tang C, Totman J, Farrow NA..  (2022)  Conformational-Design-Driven Discovery of EZM0414: A Selective, Potent SETD2 Inhibitor for Clinical Studies.,  13  (7.0): [PMID:35859865] [10.1021/acsmedchemlett.2c00167]

Source