The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((2S,3S)-3-((S)-1-(3,5-Dichlorophenyl)-2-hydroxyethoxy)-2-phenylpiperidine-1-carbonyl)-3-methylbenzoic Acid ID: ALA5170219
PubChem CID: 168271054
Max Phase: Preclinical
Molecular Formula: C28H27Cl2NO5
Molecular Weight: 528.43
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C(=O)O)ccc1C(=O)N1CCC[C@H](O[C@H](CO)c2cc(Cl)cc(Cl)c2)[C@@H]1c1ccccc1
Standard InChI: InChI=1S/C28H27Cl2NO5/c1-17-12-19(28(34)35)9-10-23(17)27(33)31-11-5-8-24(26(31)18-6-3-2-4-7-18)36-25(16-32)20-13-21(29)15-22(30)14-20/h2-4,6-7,9-10,12-15,24-26,32H,5,8,11,16H2,1H3,(H,34,35)/t24-,25+,26-/m0/s1
Standard InChI Key: GRDBZKBQOMABTH-NXCFDTQHSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
2.5018 4.1243 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5016 3.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7870 2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7868 2.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0722 1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 0.8246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3574 0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0716 -0.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0714 -1.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7857 -2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5003 -1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5005 -0.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7862 -0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 -0.8249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7864 -1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5010 -2.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5012 -2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2158 -3.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9301 -2.8866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2160 -4.1243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7868 -3.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0722 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3579 -3.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3568 -2.0626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0716 -0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0714 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3568 0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3579 2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3566 1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5011 1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2157 2.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9301 1.6488 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.2159 2.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 2 0
5 4 1 0
6 5 1 0
7 6 1 6
8 7 1 0
8 9 1 6
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 2 0
15 8 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
20 24 2 0
25 17 2 0
24 25 1 0
25 26 1 0
16 27 2 0
28 15 1 0
29 28 1 0
29 30 1 0
7 30 1 0
5 31 1 6
31 32 1 0
4 33 1 0
33 34 2 0
34 35 1 0
34 36 1 0
36 2 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.43Molecular Weight (Monoisotopic): 527.1266AlogP: 6.10#Rotatable Bonds: 7Polar Surface Area: 87.07Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.74CX Basic pKa: ┄CX LogP: 5.95CX LogD: 2.66Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -0.40
References 1. Mak VW, Patel AM, Yen R, Hanisak J, Lim YH, Bao J, Zheng R, Seganish WM, Yu Y, Healy DR, Ogawa A, Ren Z, Soriano A, Ermakov GP, Beaumont M, Metwally E, Cheng AC, Verras A, Fischmann T, Zebisch M, Silvestre HL, McEwan PA, Barker J, Rearden P, Greshock TJ.. (2022) Optimization and Mechanistic Investigations of Novel Allosteric Activators of PKG1α., 65 (15.0): [PMID:35878399 ] [10.1021/acs.jmedchem.1c02109 ]