The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-Chloro-3-(trifluoromethyl)benzene-1-sulfonyl]-L-gamma-glutamylglycyl-L-glutaminyl-L-leucyl-L-methioninamide ID: ALA5170295
PubChem CID: 168269544
Max Phase: Preclinical
Molecular Formula: C28H40ClF3N6O9S2
Molecular Weight: 761.24
Associated Items:
Names and Identifiers Canonical SMILES: CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)CC[C@H](NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1)C(=O)O)C(N)=O
Standard InChI: InChI=1S/C28H40ClF3N6O9S2/c1-14(2)12-21(26(43)36-18(24(34)41)10-11-48-3)37-25(42)19(6-8-22(33)39)35-23(40)9-7-20(27(44)45)38-49(46,47)15-4-5-17(29)16(13-15)28(30,31)32/h4-5,13-14,18-21,38H,6-12H2,1-3H3,(H2,33,39)(H2,34,41)(H,35,40)(H,36,43)(H,37,42)(H,44,45)/t18-,19-,20-,21-/m0/s1
Standard InChI Key: AEVIHOOYUWMZLD-TUFLPTIASA-N
Molfile:
RDKit 2D
49 49 0 0 0 0 0 0 0 0999 V2000
-5.7157 0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0011 1.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2892 0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2892 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9992 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7157 -0.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4303 -0.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4303 -1.2415 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.1449 -0.0037 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.1449 -0.8288 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.5746 -0.4125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.8598 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1453 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4307 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7160 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 0.8252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0009 -0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7156 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4303 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1449 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4303 -1.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7156 0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4303 1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4303 2.0629 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.1449 2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 -1.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 -2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0009 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 -1.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 0.8252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1453 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4307 -1.6503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8598 -1.6503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9879 -1.1285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1628 -1.1285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4303 1.2373 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 2.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 2.4754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 2.4754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
7 9 1 0
7 10 1 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
25 29 1 1
29 30 1 0
30 31 1 0
31 32 1 0
21 33 1 6
33 34 1 0
34 35 1 0
34 36 1 0
19 37 2 0
18 38 1 1
16 39 2 0
13 40 1 1
40 41 2 0
40 42 1 0
11 43 2 0
11 44 2 0
1 45 1 0
38 46 1 0
46 47 1 0
47 48 1 0
47 49 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 761.24Molecular Weight (Monoisotopic): 760.1939AlogP: 0.87#Rotatable Bonds: 21Polar Surface Area: 256.95Molecular Species: ACIDHBA: 9HBD: 7#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.37CX Basic pKa: ┄CX LogP: 0.31CX LogD: -3.11Aromatic Rings: 1Heavy Atoms: 49QED Weighted: 0.09Np Likeness Score: -0.84
References 1. Tabuse H, Abe-Sato K, Kanazawa H, Yashiro M, Tamura Y, Kamitani M, Hitaka K, Gunji E, Mitani A, Kojima N, Oka Y.. (2022) Discovery of Highly Potent and Selective Matrix Metalloproteinase-7 Inhibitors by Hybridizing the S1' Subsite Binder with Short Peptides., 65 (19.0): [PMID:36137271 ] [10.1021/acs.jmedchem.2c01088 ]