N-[4-Chloro-3-(trifluoromethyl)benzene-1-sulfonyl]-L-gamma-glutamylglycyl-L-phenylalanyl-L-methioninamide

ID: ALA5170327

PubChem CID: 168269992

Max Phase: Preclinical

Molecular Formula: C28H33ClF3N5O8S2

Molecular Weight: 724.18

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CC[C@H](NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1)C(=O)O)C(N)=O

Standard InChI:  InChI=1S/C28H33ClF3N5O8S2/c1-46-12-11-20(25(33)40)36-26(41)22(13-16-5-3-2-4-6-16)35-24(39)15-34-23(38)10-9-21(27(42)43)37-47(44,45)17-7-8-19(29)18(14-17)28(30,31)32/h2-8,14,20-22,37H,9-13,15H2,1H3,(H2,33,40)(H,34,38)(H,35,39)(H,36,41)(H,42,43)/t20-,21-,22-/m0/s1

Standard InChI Key:  VSAHFRSRYYEUGN-FKBYEOEOSA-N

Molfile:  

 
     RDKit          2D

 47 48  0  0  0  0  0  0  0  0999 V2000
   -5.7156    1.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0010    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2892    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2892    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9992   -0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7156    0.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4303    1.4432    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.4303   -0.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4303   -1.0355    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1449    0.2022    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1449   -0.6230    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5745   -0.2067    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8598    0.2059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1453   -0.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4306    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1453   -1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4306   -1.4443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8598   -1.4443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9879   -0.9226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1628   -0.9226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7160   -0.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -0.2067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013    1.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4278    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1425   -0.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8571    0.2059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1425   -1.0318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5718   -0.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2864    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5718   -1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2864   -1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2864    1.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0010   -0.2067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7157    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4303   -0.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7157    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4303    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4303    2.2688    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.1449    2.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1449    0.2059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4303   -1.0318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0012   -1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7133   -1.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7133   -2.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0030   -2.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2864   -2.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  1  7  1  0
  6  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  4 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  2  0
 16 18  1  0
 12 19  2  0
 12 20  2  0
 15 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  1  0
 29 31  1  6
 31 32  1  0
 30 33  2  0
 30 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  1  1
 37 38  1  0
 38 39  1  0
 39 40  1  0
 36 41  1  0
 36 42  2  0
 43 32  2  0
 44 43  1  0
 45 44  2  0
 46 45  1  0
 47 46  2  0
 32 47  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5170327

    ---

Associated Targets(Human)

MMP7 Tchem Matrix metalloproteinase 7 (1073 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 724.18Molecular Weight (Monoisotopic): 723.1411AlogP: 1.44#Rotatable Bonds: 18
Polar Surface Area: 213.86Molecular Species: ACIDHBA: 8HBD: 6
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.21CX Basic pKa: CX LogP: 1.30CX LogD: -2.15
Aromatic Rings: 2Heavy Atoms: 47QED Weighted: 0.13Np Likeness Score: -1.05

References

1. Tabuse H, Abe-Sato K, Kanazawa H, Yashiro M, Tamura Y, Kamitani M, Hitaka K, Gunji E, Mitani A, Kojima N, Oka Y..  (2022)  Discovery of Highly Potent and Selective Matrix Metalloproteinase-7 Inhibitors by Hybridizing the S1' Subsite Binder with Short Peptides.,  65  (19.0): [PMID:36137271] [10.1021/acs.jmedchem.2c01088]

Source