2-isobutoxy-6-phenoxynicotinic acid

ID: ALA5170330

PubChem CID: 168270110

Max Phase: Preclinical

Molecular Formula: C16H17NO4

Molecular Weight: 287.32

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)COc1nc(Oc2ccccc2)ccc1C(=O)O

Standard InChI:  InChI=1S/C16H17NO4/c1-11(2)10-20-15-13(16(18)19)8-9-14(17-15)21-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H,18,19)

Standard InChI Key:  JCNHZDPJQCVZKQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
   -0.4018    1.6063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1162    1.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1162    0.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4018   -0.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3126    0.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3126    1.1938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0270   -0.0438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0270   -0.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3127   -1.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3126   -2.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0270   -2.5189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7415   -2.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7416   -1.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8307    1.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5451    1.1937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8307    2.4312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4018    2.4312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1163    2.8437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1163    3.6687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8308    4.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4019    4.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
  8  9  2  0
 13  8  1  0
  2 14  1  0
 14 15  2  0
 14 16  1  0
  1 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5170330

    ---

Associated Targets(Human)

MCL1 Tchem MCL1-BAK1 complex (39 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 287.32Molecular Weight (Monoisotopic): 287.1158AlogP: 3.61#Rotatable Bonds: 6
Polar Surface Area: 68.65Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.47CX Basic pKa: 0.02CX LogP: 4.19CX LogD: 1.36
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.88Np Likeness Score: -0.84

References

1. Negi A, Murphy PV..  (2021)  Development of Mcl-1 inhibitors for cancer therapy.,  210  [PMID:33333396] [10.1016/j.ejmech.2020.113038]

Source