Aspulvinone H

ID: ALA5170907

Cas Number: 57744-69-1

PubChem CID: 54675755

Max Phase: Preclinical

Molecular Formula: C27H28O5

Molecular Weight: 432.52

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CCc1cc(/C=C2\OC(=O)C(c3ccc(O)c(CC=C(C)C)c3)=C2O)ccc1O

Standard InChI:  InChI=1S/C27H28O5/c1-16(2)5-8-19-13-18(7-11-22(19)28)14-24-26(30)25(27(31)32-24)21-10-12-23(29)20(15-21)9-6-17(3)4/h5-7,10-15,28-30H,8-9H2,1-4H3/b24-14-

Standard InChI Key:  LFDYHAWYVIBCDT-OYKKKHCWSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   -1.6795   -1.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9649   -1.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2529   -1.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2529   -2.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9630   -3.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6795   -2.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9630   -3.9842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3940   -3.1636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1087   -2.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8234   -3.1636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5379   -2.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8234   -3.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9649   -0.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2502   -0.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2502    0.5527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5539    0.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0247    0.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5326   -0.5183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8498    0.1492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9649    0.9652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7674    1.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1841    2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3977    2.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1951    3.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7767    2.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5679    1.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4086    3.9888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5738    2.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1573    2.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9544    2.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5379    1.8724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1680    3.2530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  5  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 10 12  1  0
  2 13  1  0
 13 14  2  0
 15 14  1  0
 15 16  2  0
 16 17  1  0
 18 17  1  0
 14 18  1  0
 17 19  2  0
 15 20  1  0
 16 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
 24 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5170907

    Aspulvinone H

Associated Targets(Human)

GOT1 Tbio Aspartate aminotransferase, cytoplasmic (118 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.52Molecular Weight (Monoisotopic): 432.1937AlogP: 5.98#Rotatable Bonds: 6
Polar Surface Area: 86.99Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.91CX Basic pKa: CX LogP: 6.21CX LogD: 5.58
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: 1.15

References

1. Wu Q, Sun Z, Chen Z, Liu J, Ding H, Luo C, Wang M, Du D..  (2022)  The discovery of a non-competitive GOT1 inhibitor, hydralazine hydrochloride, via a coupling reaction-based high-throughput screening assay.,  73  [PMID:35820623] [10.1016/j.bmcl.2022.128883]

Source