The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Aspulvinone H ID: ALA5170907
Cas Number: 57744-69-1
PubChem CID: 54675755
Max Phase: Preclinical
Molecular Formula: C27H28O5
Molecular Weight: 432.52
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=CCc1cc(/C=C2\OC(=O)C(c3ccc(O)c(CC=C(C)C)c3)=C2O)ccc1O
Standard InChI: InChI=1S/C27H28O5/c1-16(2)5-8-19-13-18(7-11-22(19)28)14-24-26(30)25(27(31)32-24)21-10-12-23(29)20(15-21)9-6-17(3)4/h5-7,10-15,28-30H,8-9H2,1-4H3/b24-14-
Standard InChI Key: LFDYHAWYVIBCDT-OYKKKHCWSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-1.6795 -1.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9649 -1.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2529 -1.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2529 -2.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9630 -3.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6795 -2.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9630 -3.9842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3940 -3.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1087 -2.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8234 -3.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5379 -2.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8234 -3.9888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9649 -0.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2502 -0.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2502 0.5527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5539 0.8029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0247 0.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5326 -0.5183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8498 0.1492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9649 0.9652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7674 1.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1841 2.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3977 2.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1951 3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7767 2.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5679 1.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4086 3.9888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5738 2.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1573 2.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9544 2.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5379 1.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1680 3.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
5 7 1 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
10 12 1 0
2 13 1 0
13 14 2 0
15 14 1 0
15 16 2 0
16 17 1 0
18 17 1 0
14 18 1 0
17 19 2 0
15 20 1 0
16 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
24 27 1 0
25 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.52Molecular Weight (Monoisotopic): 432.1937AlogP: 5.98#Rotatable Bonds: 6Polar Surface Area: 86.99Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.91CX Basic pKa: ┄CX LogP: 6.21CX LogD: 5.58Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: 1.15
References 1. Wu Q, Sun Z, Chen Z, Liu J, Ding H, Luo C, Wang M, Du D.. (2022) The discovery of a non-competitive GOT1 inhibitor, hydralazine hydrochloride, via a coupling reaction-based high-throughput screening assay., 73 [PMID:35820623 ] [10.1016/j.bmcl.2022.128883 ]