N-(5-(N,N-diethylsulfamoyl)-2-methoxyphenyl)-4-oxo-3-propyl-3,4-dihydrophthalazine-1-carboxamide

ID: ALA5171557

PubChem CID: 3287649

Max Phase: Preclinical

Molecular Formula: C23H28N4O5S

Molecular Weight: 472.57

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCn1nc(C(=O)Nc2cc(S(=O)(=O)N(CC)CC)ccc2OC)c2ccccc2c1=O

Standard InChI:  InChI=1S/C23H28N4O5S/c1-5-14-27-23(29)18-11-9-8-10-17(18)21(25-27)22(28)24-19-15-16(12-13-20(19)32-4)33(30,31)26(6-2)7-3/h8-13,15H,5-7,14H2,1-4H3,(H,24,28)

Standard InChI Key:  RQYCLUQRIBDANT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   -1.4218   -0.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4218   -1.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7085   -2.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -1.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7103   -0.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7100   -0.4107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4218   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1334   -0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1334    0.4108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8450    0.8216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5566    0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5566   -0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8450   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8450   -1.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5588   -2.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2659   -1.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2659   -0.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2682    0.8216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8450    1.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4218   -1.6433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7100   -2.0541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7100   -2.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1334   -0.4112    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8450   -0.8219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5567   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2682   -0.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8450   -1.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5567   -2.0546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7218    0.3017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5442    0.3017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1334    2.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1334    2.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 13 18  1  0
 12 19  2  0
 11 20  1  0
  8 21  2  0
  4 22  1  0
 22 23  1  0
  1 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 28 29  1  0
 24 30  2  0
 24 31  2  0
 20 32  1  0
 32 33  1  0
M  END

Associated Targets(Human)

NFATC1 Tchem Nuclear factor of activated T-cells cytoplasmic 1 (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.57Molecular Weight (Monoisotopic): 472.1780AlogP: 3.10#Rotatable Bonds: 9
Polar Surface Area: 110.60Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.10CX Basic pKa: CX LogP: 2.94CX LogD: 2.94
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -2.12

References

1. Sánchez-Morales A, Biçer A, Panagiotopoulos V, Crecente-Garcia S, Benaiges C, Bayod S, Luís Hernández J, Busqué F, Matsoukas MT, Pérez-Riba M, Alibés R..  (2022)  Design and synthesis of a novel non peptide CN-NFATc signaling inhibitor for tumor suppression in triple negative breast cancer.,  238  [PMID:35700596] [10.1016/j.ejmech.2022.114514]

Source