The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(N,N-diethylsulfamoyl)-2-methoxyphenyl)-4-oxo-3-propyl-3,4-dihydrophthalazine-1-carboxamide ID: ALA5171557
PubChem CID: 3287649
Max Phase: Preclinical
Molecular Formula: C23H28N4O5S
Molecular Weight: 472.57
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCn1nc(C(=O)Nc2cc(S(=O)(=O)N(CC)CC)ccc2OC)c2ccccc2c1=O
Standard InChI: InChI=1S/C23H28N4O5S/c1-5-14-27-23(29)18-11-9-8-10-17(18)21(25-27)22(28)24-19-15-16(12-13-20(19)32-4)33(30,31)26(6-2)7-3/h8-13,15H,5-7,14H2,1-4H3,(H,24,28)
Standard InChI Key: RQYCLUQRIBDANT-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-1.4218 -0.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4218 -1.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7085 -2.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 -1.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 -0.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7103 -0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7100 -0.4107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4218 -0.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1334 -0.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1334 0.4108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8450 0.8216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5566 0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5566 -0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8450 -0.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8450 -1.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5588 -2.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2659 -1.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2659 -0.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2682 0.8216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8450 1.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4218 -1.6433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7100 -2.0541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7100 -2.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1334 -0.4112 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.8450 -0.8219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5567 -0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2682 -0.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8450 -1.6437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5567 -2.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7218 0.3017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5442 0.3017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1334 2.0541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1334 2.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
8 9 1 0
10 9 2 0
11 10 1 0
12 11 1 0
13 12 1 0
14 13 2 0
9 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
13 18 1 0
12 19 2 0
11 20 1 0
8 21 2 0
4 22 1 0
22 23 1 0
1 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
24 30 2 0
24 31 2 0
20 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.57Molecular Weight (Monoisotopic): 472.1780AlogP: 3.10#Rotatable Bonds: 9Polar Surface Area: 110.60Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.10CX Basic pKa: ┄CX LogP: 2.94CX LogD: 2.94Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -2.12
References 1. Sánchez-Morales A, Biçer A, Panagiotopoulos V, Crecente-Garcia S, Benaiges C, Bayod S, Luís Hernández J, Busqué F, Matsoukas MT, Pérez-Riba M, Alibés R.. (2022) Design and synthesis of a novel non peptide CN-NFATc signaling inhibitor for tumor suppression in triple negative breast cancer., 238 [PMID:35700596 ] [10.1016/j.ejmech.2022.114514 ]