The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(trans)-(S)-4-(3-(2-hydroxy-2-methylpropyl)phenoxy)-N-methyl-N-(3-methyl-4-((3-methylpiperazin-1-yl)methyl)phenyl)cyclohexanecarboxamide ID: ALA5171964
PubChem CID: 89723511
Max Phase: Preclinical
Molecular Formula: C31H45N3O3
Molecular Weight: 507.72
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(N(C)C(=O)[C@H]2CC[C@H](Oc3cccc(CC(C)(C)O)c3)CC2)ccc1CN1CCN[C@@H](C)C1
Standard InChI: InChI=1S/C31H45N3O3/c1-22-17-27(12-9-26(22)21-34-16-15-32-23(2)20-34)33(5)30(35)25-10-13-28(14-11-25)37-29-8-6-7-24(18-29)19-31(3,4)36/h6-9,12,17-18,23,25,28,32,36H,10-11,13-16,19-21H2,1-5H3/t23-,25-,28-/m0/s1
Standard InChI Key: WJSQLBBIUNNJAB-AGJHTDJMSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-4.2847 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5703 1.8570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8557 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8557 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5703 0.2069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2847 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5703 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8559 -1.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1415 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4298 -1.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4298 -1.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1397 -2.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8559 -1.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5703 -2.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7154 -2.2672 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0011 -1.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0011 -1.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7154 -0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7154 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0011 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7130 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7130 -0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0011 1.4442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 1.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7133 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4258 3.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1403 2.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1419 1.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4302 1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7130 -2.2672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7154 -3.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1415 1.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8561 1.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5705 1.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2847 1.4463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9836 2.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1589 2.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
13 14 1 0
11 15 1 0
15 16 1 0
17 16 1 1
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
17 22 1 0
20 23 1 6
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
16 30 2 0
15 31 1 0
3 32 1 1
28 33 1 0
33 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.72Molecular Weight (Monoisotopic): 507.3461AlogP: 4.70#Rotatable Bonds: 8Polar Surface Area: 65.04Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.35CX LogP: 4.69CX LogD: 2.76Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.54Np Likeness Score: -0.71
References 1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M.. (2022) Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure., 59 [PMID:35051575 ] [10.1016/j.bmcl.2022.128554 ]