The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R,S)-(2-Ethyny1-3-hydroxy-2-(phosphonomethoxy)propy)-adenine Triethylammonium Salt ID: ALA5172019
PubChem CID: 168270789
Max Phase: Preclinical
Molecular Formula: C17H29N6O5P
Molecular Weight: 327.24
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CC(CO)(Cn1cnc2c(N)ncnc21)OCP(=O)(O)O.CCN(CC)CC
Standard InChI: InChI=1S/C11H14N5O5P.C6H15N/c1-2-11(4-17,21-7-22(18,19)20)3-16-6-15-8-9(12)13-5-14-10(8)16;1-4-7(5-2)6-3/h1,5-6,17H,3-4,7H2,(H2,12,13,14)(H2,18,19,20);4-6H2,1-3H3
Standard InChI Key: QVDFWQYJBZNYIY-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
-0.0246 -2.4283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6892 -2.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4033 -2.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7385 -2.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4527 -2.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0246 -1.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7385 -1.1913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3325 -0.0373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6163 0.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6163 1.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3325 1.6090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0445 1.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7566 1.6090 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
2.7566 0.7858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4687 1.1953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7566 2.4322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0956 1.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8077 1.1953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8921 0.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7111 0.2075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1248 0.9196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5507 1.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8223 2.3210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6187 2.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1662 1.8806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9213 1.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4687 0.4833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6163 2.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6103 2.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 1 0
4 5 1 0
1 6 1 0
6 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
13 16 2 0
10 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
18 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
21 26 1 0
26 27 1 0
10 28 1 0
28 29 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 327.24Molecular Weight (Monoisotopic): 327.0733AlogP: -1.08#Rotatable Bonds: 6Polar Surface Area: 156.61Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.35CX Basic pKa: 4.68CX LogP: -4.40CX LogD: -4.54Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.38Np Likeness Score: -0.21
References 1. Tan S, Groaz E, Kalkeri R, Ptak R, Korba BE, Herdewijn P.. (2022) Reshaping an Acyclic Nucleoside Phosphonate into a Selective Anti-hepatitis B Virus Compound., 65 (13.0): [PMID:35754374 ] [10.1021/acs.jmedchem.2c00667 ]