Cudraphenone A

ID: ALA517213

PubChem CID: 11793144

Max Phase: Preclinical

Molecular Formula: C23H24O4

Molecular Weight: 364.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CCc1c(O)cccc1C(=O)c1cc2c(cc1O)OC(C)(C)C=C2

Standard InChI:  InChI=1S/C23H24O4/c1-14(2)8-9-16-17(6-5-7-19(16)24)22(26)18-12-15-10-11-23(3,4)27-21(15)13-20(18)25/h5-8,10-13,24-25H,9H2,1-4H3

Standard InChI Key:  KOJDUQIWHNYJEM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   -4.4014    0.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4026   -0.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6878   -0.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9713   -0.2352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9742    0.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6896    1.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1160    1.0040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6920    1.8295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4077    2.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4102    3.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1259    3.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6970    3.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2613    1.0105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5453    0.6007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2644    1.8355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5455   -0.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1222    0.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8380    1.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8453    1.8438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1164   -0.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8336   -0.6297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8342   -1.4529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1194   -1.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5978   -1.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6001   -0.6262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5917   -2.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4208   -1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
 13 14  1  0
  1  7  1  0
 13 15  2  0
  3  4  2  0
 14 16  2  0
 16 21  1  0
  6  8  1  0
 20 17  1  0
 17 18  2  0
 18 14  1  0
  8  9  1  0
 18 19  1  0
 20 21  2  0
  4  5  1  0
  9 10  2  0
  2  3  1  0
 10 11  1  0
  5  6  2  0
 10 12  1  0
 20 25  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
  6  1  1  0
 24 26  1  0
  5 13  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

HSC-2 (771 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.44Molecular Weight (Monoisotopic): 364.1675AlogP: 5.02#Rotatable Bonds: 4
Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.15CX Basic pKa: CX LogP: 6.10CX LogD: 5.65
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: 1.97

References

1. Hou A, Fukai T, Shimazaki M, Sakagami H, Sun H, Nomura T..  (2001)  Benzophenones and xanthones with isoprenoid groups from Cudrania cochinchinensis.,  64  (1): [PMID:11170668] [10.1021/np000406p]

Source