2-((2-(1-benzylpiperidin-4-yl)ethyl)amino)-N-(9H-carbazol-9-yl)acetamide

ID: ALA5172194

PubChem CID: 168269649

Max Phase: Preclinical

Molecular Formula: C28H32N4O

Molecular Weight: 440.59

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CNCCC1CCN(Cc2ccccc2)CC1)Nn1c2ccccc2c2ccccc21

Standard InChI:  InChI=1S/C28H32N4O/c33-28(30-32-26-12-6-4-10-24(26)25-11-5-7-13-27(25)32)20-29-17-14-22-15-18-31(19-16-22)21-23-8-2-1-3-9-23/h1-13,22,29H,14-21H2,(H,30,33)

Standard InChI Key:  PPRNCCNQDXANAH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -5.3520    0.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6374    1.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9255    0.7584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9255   -0.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6356   -0.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3520   -0.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1213    1.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6505    0.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1426   -0.3125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7912    1.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9895    1.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5196    1.1725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8457    0.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9290   -1.1096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1319   -1.3232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9184   -2.1203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5484   -0.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7513   -0.9532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1678   -0.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6291   -0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9990    0.7971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5825    1.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3796    1.1670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5932    0.3700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0097   -0.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9631    1.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7601    1.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3438    2.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1383    1.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3520    1.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7725    0.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9746    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  3  7  1  0
  7  8  2  0
  9  8  1  0
  4  9  1  0
  7 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
  9 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 21 26  1  0
 24 27  1  0
 27 28  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5172194

    ---

Associated Targets(non-human)

Ebolavirus (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.59Molecular Weight (Monoisotopic): 440.2576AlogP: 4.76#Rotatable Bonds: 8
Polar Surface Area: 49.30Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.51CX Basic pKa: 9.44CX LogP: 3.92CX LogD: 0.79
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -0.94

References

1. Morales-Tenorio M, Ginex T, Cuesta-Geijo MÁ, Campillo NE, Muñoz-Fontela C, Alonso C, Delgado R, Gil C..  (2021)  Potential pharmacological strategies targeting the Niemann-Pick C1 receptor and Ebola virus glycoprotein interaction.,  223  [PMID:34175537] [10.1016/j.ejmech.2021.113654]
2. Han S, Li H, Chen W, Yang L, Tong X, Zuo J, Hu Y..  (2022)  Discovery of potent ebola entry inhibitors with (3S,4aS,8aS)-2-(3-amino-2-hydroxypropyl) decahydroisoquinoline-3-carboxamide scaffold.,  240  [PMID:35872393] [10.1016/j.ejmech.2022.114608]

Source