The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(4-tert-butylbenzylamino)propyl)-3,5-bis(trifluoromethyl)benzenesulfonamide ID: ALA5172198
PubChem CID: 168269652
Max Phase: Preclinical
Molecular Formula: C22H26F6N2O2S
Molecular Weight: 496.52
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1ccc(CNCCCNS(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1
Standard InChI: InChI=1S/C22H26F6N2O2S/c1-20(2,3)16-7-5-15(6-8-16)14-29-9-4-10-30-33(31,32)19-12-17(21(23,24)25)11-18(13-19)22(26,27)28/h5-8,11-13,29-30H,4,9-10,14H2,1-3H3
Standard InChI Key: VJGCZXULWOXTIL-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
1.4302 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7157 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0013 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7131 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4276 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 1.2375 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8567 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5694 -0.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2841 0.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2857 0.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5740 1.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0002 1.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7146 0.8229 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.0002 2.0604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.7146 1.6479 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.5694 -1.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8550 -1.6480 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.2839 -1.6480 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.5694 -2.0604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7288 1.9533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5537 1.9533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1447 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8591 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5738 1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2857 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2857 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5755 -0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8591 -0.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0002 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7146 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0002 -1.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7146 -0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
7 12 1 0
11 13 1 0
13 14 1 0
13 15 1 0
13 16 1 0
9 17 1 0
17 18 1 0
17 19 1 0
17 20 1 0
6 21 2 0
6 22 2 0
1 23 1 0
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
27 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.52Molecular Weight (Monoisotopic): 496.1619AlogP: 5.48#Rotatable Bonds: 8Polar Surface Area: 58.20Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.95CX Basic pKa: 9.25CX LogP: 5.10CX LogD: 3.56Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -1.25
References 1. Sun J, Ambrus JI, Baker JR, Russell CC, Cossar PJ, Sakoff JA, Scarlett CJ, McCluskey A.. (2022) 3,5-Bis(trifluoromethyl)phenylsulfonamides, a novel pancreatic cancer active lead. Investigation of the terminal aromatic moiety., 61 [PMID:35114371 ] [10.1016/j.bmcl.2022.128591 ]