4-(2-(4-Benzhydrylpiperazin-1-yl)ethyl)-N-hydroxybenzamide

ID: ALA5172611

PubChem CID: 168271166

Max Phase: Preclinical

Molecular Formula: C26H29N3O2

Molecular Weight: 415.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NO)c1ccc(CCN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1

Standard InChI:  InChI=1S/C26H29N3O2/c30-26(27-31)24-13-11-21(12-14-24)15-16-28-17-19-29(20-18-28)25(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,25,31H,15-20H2,(H,27,30)

Standard InChI Key:  CJSCFEBBGAGVJI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -3.7119   -0.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2882   -0.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4633   -0.0130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0621   -0.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2373   -0.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8135   -0.0522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0112   -0.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4124   -0.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2373   -0.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6610   -0.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4859   -0.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8870   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7119   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1356   -0.1306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9606   -0.1306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1130   -1.5592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4633   -1.5331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6384   -1.5331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2145    0.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0396    0.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6893    0.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2655    1.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6667    2.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4915    2.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9153    1.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5141    0.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5368   -0.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9606   -1.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5594   -2.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7346   -2.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3107   -1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  6  5  1  0
  6  7  1  0
  8  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 12 11  1  0
 12 13  1  0
 13 14  1  0
 15 14  1  0
 13 16  2  0
 12 17  2  0
 17 18  1  0
 18  9  2  0
  6 19  1  0
 19 20  1  0
 20  3  1  0
 21  2  1  0
 21 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 21 26  2  0
  1 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
  1 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5172611

    ---

Associated Targets(Human)

HDAC1 Tclin Histone deacetylase 1 (10854 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HDAC4 Tclin Histone deacetylase 4 (2328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hdac6 Histone deacetylase 6 (222 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.54Molecular Weight (Monoisotopic): 415.2260AlogP: 3.76#Rotatable Bonds: 7
Polar Surface Area: 55.81Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.24CX Basic pKa: 8.12CX LogP: 4.14CX LogD: 3.58
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -0.97

References

1. Hashimoto K, Ide S, Arata M, Nakata A, Ito A, Ito TK, Kudo N, Lin B, Nunomura K, Tsuganezawa K, Yoshida M, Nagaoka Y, Sumiyoshi T..  (2022)  Discovery of Benzylpiperazine Derivatives as CNS-Penetrant and Selective Histone Deacetylase 6 Inhibitors.,  13  (7.0): [PMID:35859864] [10.1021/acsmedchemlett.2c00081]

Source