The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((5-chloro-4-((2-(methylcarbamoyl)phenyl)amino)pyrimidin-2-yl)amino)-N,N,2-trimethyl-1H-indole-3-carboxamide ID: ALA5172782
PubChem CID: 154640729
Max Phase: Preclinical
Molecular Formula: C24H24ClN7O2
Molecular Weight: 477.96
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1ccccc1Nc1nc(Nc2ccc3c(C(=O)N(C)C)c(C)[nH]c3c2)ncc1Cl
Standard InChI: InChI=1S/C24H24ClN7O2/c1-13-20(23(34)32(3)4)15-10-9-14(11-19(15)28-13)29-24-27-12-17(25)21(31-24)30-18-8-6-5-7-16(18)22(33)26-2/h5-12,28H,1-4H3,(H,26,33)(H2,27,29,30,31)
Standard InChI Key: NQJLJKFROUEMTA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-2.6454 1.0522 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.9303 0.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2097 1.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4915 0.6451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4963 -0.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2169 -0.5987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9326 -0.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6487 -0.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3649 -0.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1551 -0.4449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6435 0.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4686 0.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1551 0.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4100 1.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2170 1.8555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8579 2.2971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3649 0.6425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6487 1.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9326 0.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2169 -0.5945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9278 -0.1842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6447 -0.5925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3597 -0.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3482 0.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0560 1.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7766 0.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7955 -0.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0804 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0858 -1.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3738 -1.8198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8006 -1.8150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8006 -2.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4721 2.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8006 1.2718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
4 3 1 0
4 5 2 0
6 5 1 0
7 6 1 0
7 8 2 0
9 8 1 0
9 10 1 0
10 11 1 0
12 11 1 0
11 13 2 0
14 13 1 0
15 14 1 0
14 16 2 0
17 13 1 0
17 9 2 0
17 18 1 0
18 19 2 0
19 7 1 0
5 20 1 0
20 21 2 0
21 2 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
28 27 1 0
28 23 2 0
28 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
15 33 1 0
15 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.96Molecular Weight (Monoisotopic): 477.1680AlogP: 4.47#Rotatable Bonds: 6Polar Surface Area: 115.04Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.62CX Basic pKa: 2.56CX LogP: 4.78CX LogD: 4.78Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -1.68
References 1. Guo M, Wang H, Yang J, Wang X, Zhang J, Liu S, Wei S, Jiang N, Zhai X.. (2022) Identification and anti-tumor evaluation of 3-acyl-indol-based 2,4-diarylaminopyrimidine analogues as potent ALK inhibitors capable of overcoming drug-resistant mutants., 238 [PMID:35691173 ] [10.1016/j.ejmech.2022.114493 ]