The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Alstomairine C ID: ALA5172840
PubChem CID: 168276814
Max Phase: Preclinical
Molecular Formula: C21H25N2O4+
Molecular Weight: 369.44
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C2Nc3c(O)cccc3[C@]23CC[N+]2(C)C[C@H](C(C)=O)[C@H]1C[C@H]32
Standard InChI: InChI=1S/C21H24N2O4/c1-11(24)13-10-23(2)8-7-21-14-5-4-6-15(25)18(14)22-19(21)17(20(26)27-3)12(13)9-16(21)23/h4-6,12-13,16H,7-10H2,1-3H3,(H-,22,25,26)/p+1/t12-,13-,16-,21+,23?/m1/s1
Standard InChI Key: NURWNDRJIWXQQY-VWKKCNPTSA-O
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
-2.7517 -0.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0372 0.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3251 -0.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3251 -1.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0354 -1.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7517 -1.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5404 -1.2828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0553 -0.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5402 0.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2045 0.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6161 0.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1011 0.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7653 -0.5291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7517 0.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3391 0.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5137 0.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0331 1.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2078 1.5208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2784 2.1267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8412 1.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8158 -0.1879 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.4181 1.6033 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0354 -2.2650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1780 -1.2439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0032 -1.2439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4159 -1.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7653 -1.9586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7517 1.6541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5648 2.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
8 7 1 0
3 9 1 0
9 8 1 0
9 10 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 2 0
15 14 1 0
12 16 1 0
16 15 1 6
16 17 1 0
10 18 1 0
18 17 1 0
18 19 1 0
9 20 1 6
20 19 1 0
12 21 1 1
10 22 1 1
5 23 1 0
13 24 1 0
24 25 1 0
25 26 1 0
24 27 2 0
15 28 2 0
18 29 1 0
M CHG 1 18 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 369.44Molecular Weight (Monoisotopic): 369.1809AlogP: 1.94#Rotatable Bonds: 2Polar Surface Area: 75.63Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.74CX Basic pKa: ┄CX LogP: -3.31CX LogD: -3.13Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.47Np Likeness Score: 2.04