The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Penijanthine C ID: ALA5172906
PubChem CID: 156582122
Max Phase: Preclinical
Molecular Formula: C28H41NO3
Molecular Weight: 439.64
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(O)[C@H](O)CC[C@]1(C)[C@@H](O)CC[C@@]2(C)[C@H]1CC[C@H]1Cc3c([nH]c4ccccc34)[C@@]12C
Standard InChI: InChI=1S/C28H41NO3/c1-25(2,32)22(30)12-14-26(3)21-11-10-17-16-19-18-8-6-7-9-20(18)29-24(19)28(17,5)27(21,4)15-13-23(26)31/h6-9,17,21-23,29-32H,10-16H2,1-5H3/t17-,21-,22+,23-,26-,27-,28+/m0/s1
Standard InChI Key: XUDVKTPTAOVMJY-FNCFULCPSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-3.3147 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0291 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0291 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3147 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6002 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6002 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8157 -0.6675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3307 -0.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8155 0.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5460 0.2545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5459 1.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3304 1.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1684 -0.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8828 0.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8831 1.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1686 1.4920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1683 -0.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8828 -1.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5973 -0.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5973 -0.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5459 1.9045 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.5460 -0.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1684 0.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8828 -0.5706 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.3118 -1.3957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3118 0.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5973 0.6668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0263 -0.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7408 0.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7407 1.0794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4552 -0.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4552 -0.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1697 0.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1697 -0.5705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
8 9 2 0
6 9 1 0
10 11 1 0
11 12 1 0
8 10 1 0
9 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
10 13 1 0
11 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
13 17 1 0
14 20 1 0
7 8 1 0
5 7 1 0
11 21 1 1
10 22 1 6
13 23 1 1
14 24 1 6
19 25 1 1
20 26 1 0
20 27 1 1
26 28 1 0
28 29 1 0
29 31 1 0
29 30 1 1
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.64Molecular Weight (Monoisotopic): 439.3086AlogP: 5.09#Rotatable Bonds: 4Polar Surface Area: 76.48Molecular Species: NEUTRALHBA: 3HBD: 4#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.85CX Basic pKa: ┄CX LogP: 4.47CX LogD: 4.47Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: 2.53
References 1. Zhao M, Tang Y, Xie J, Zhao Z, Cui H.. (2021) Meroterpenoids produced by fungi: Occurrence, structural diversity, biological activities, and their molecular targets., 209 [PMID:33032085 ] [10.1016/j.ejmech.2020.112860 ]