Penijanthine C

ID: ALA5172906

PubChem CID: 156582122

Max Phase: Preclinical

Molecular Formula: C28H41NO3

Molecular Weight: 439.64

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(O)[C@H](O)CC[C@]1(C)[C@@H](O)CC[C@@]2(C)[C@H]1CC[C@H]1Cc3c([nH]c4ccccc34)[C@@]12C

Standard InChI:  InChI=1S/C28H41NO3/c1-25(2,32)22(30)12-14-26(3)21-11-10-17-16-19-18-8-6-7-9-20(18)29-24(19)28(17,5)27(21,4)15-13-23(26)31/h6-9,17,21-23,29-32H,10-16H2,1-5H3/t17-,21-,22+,23-,26-,27-,28+/m0/s1

Standard InChI Key:  XUDVKTPTAOVMJY-FNCFULCPSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -3.3147    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0291    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0291   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3147   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6002   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6002    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8157   -0.6675    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3307   -0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8155    0.6672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5460    0.2545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5459    1.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3304    1.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1684   -0.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8828    0.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8831    1.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1686    1.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1683   -0.9831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8828   -1.3956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5973   -0.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5973   -0.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5459    1.9045    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5460   -0.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1684    0.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8828   -0.5706    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3118   -1.3957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3118    0.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5973    0.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0263   -0.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7408    0.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7407    1.0794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4552   -0.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4552   -0.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1697    0.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1697   -0.5705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  8  9  2  0
  6  9  1  0
 10 11  1  0
 11 12  1  0
  8 10  1  0
  9 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 10 13  1  0
 11 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 13 17  1  0
 14 20  1  0
  7  8  1  0
  5  7  1  0
 11 21  1  1
 10 22  1  6
 13 23  1  1
 14 24  1  6
 19 25  1  1
 20 26  1  0
 20 27  1  1
 26 28  1  0
 28 29  1  0
 29 31  1  0
 29 30  1  1
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5172906

    ---

Associated Targets(non-human)

Vibrio anguillarum (183 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vibrio parahaemolyticus (473 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vibrio alginolyticus (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.64Molecular Weight (Monoisotopic): 439.3086AlogP: 5.09#Rotatable Bonds: 4
Polar Surface Area: 76.48Molecular Species: NEUTRALHBA: 3HBD: 4
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.85CX Basic pKa: CX LogP: 4.47CX LogD: 4.47
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: 2.53

References

1. Zhao M, Tang Y, Xie J, Zhao Z, Cui H..  (2021)  Meroterpenoids produced by fungi: Occurrence, structural diversity, biological activities, and their molecular targets.,  209  [PMID:33032085] [10.1016/j.ejmech.2020.112860]

Source