(R)-3-(3',5'-dichloro-4'-methoxybiphenyl-3-yl)-2-(5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamido)propanoic acid

ID: ALA5173145

PubChem CID: 163198541

Max Phase: Preclinical

Molecular Formula: C25H21Cl2N3O5

Molecular Weight: 514.37

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1c(Cl)cc(-c2cccc(C[C@@H](NC(=O)c3cc(-c4ccc(C)o4)[nH]n3)C(=O)O)c2)cc1Cl

Standard InChI:  InChI=1S/C25H21Cl2N3O5/c1-13-6-7-22(35-13)19-12-20(30-29-19)24(31)28-21(25(32)33)9-14-4-3-5-15(8-14)16-10-17(26)23(34-2)18(27)11-16/h3-8,10-12,21H,9H2,1-2H3,(H,28,31)(H,29,30)(H,32,33)/t21-/m1/s1

Standard InChI Key:  NKUFZFKCAIBESU-OAQYLSRUSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   15.7685  -17.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3598  -17.1477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3495  -18.5752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5259  -18.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1111  -19.2801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1214  -17.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5362  -17.1418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2979  -17.8466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5157  -19.9967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0969  -20.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5008  -21.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3252  -21.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7440  -20.7091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3336  -20.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5921  -17.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0736  -18.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8587  -18.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8647  -17.4641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0833  -17.2041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5192  -18.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5134  -19.5900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2910  -19.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7774  -19.1893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3003  -18.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5385  -20.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0884  -22.1210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2678  -22.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8518  -22.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2552  -23.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0790  -23.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4913  -22.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4848  -24.2483    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.0325  -22.8099    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.8402  -24.2383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0208  -24.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  4  5  1  6
  4  6  1  0
  6  7  2  0
  6  8  1  0
  5  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  1 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 15  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 20  2  0
 17 20  1  0
 22 25  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 11 26  1  0
 30 32  1  0
 28 33  1  0
 29 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5173145

    ---

Associated Targets(Human)

ALPP Tbio Alkaline phosphatase placental type (103 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALPL Tchem Alkaline phosphatase, tissue-nonspecific isozyme (1551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 514.37Molecular Weight (Monoisotopic): 513.0858AlogP: 5.39#Rotatable Bonds: 8
Polar Surface Area: 117.45Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.12CX Basic pKa: 0.05CX LogP: 4.97CX LogD: 1.86
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -0.89

References

1. Bassi G, Favalli N, Pellegrino C, Onda Y, Scheuermann J, Cazzamalli S, Manz MG, Neri D..  (2021)  Specific Inhibitor of Placental Alkaline Phosphatase Isolated from a DNA-Encoded Chemical Library Targets Tumor of the Female Reproductive Tract.,  64  (21.0): [PMID:34709820] [10.1021/acs.jmedchem.1c01103]

Source