The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(1H-indazol-6-yl)-N2-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-5-methyl-pyrimidine-2,4-diamine ID: ALA5173185
PubChem CID: 156704697
Max Phase: Preclinical
Molecular Formula: C24H28N8O
Molecular Weight: 444.54
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Nc2ncc(C)c(Nc3ccc4cn[nH]c4c3)n2)ccc1N1CCN(C)CC1
Standard InChI: InChI=1S/C24H28N8O/c1-16-14-25-24(29-23(16)27-18-5-4-17-15-26-30-20(17)12-18)28-19-6-7-21(22(13-19)33-3)32-10-8-31(2)9-11-32/h4-7,12-15H,8-11H2,1-3H3,(H,26,30)(H2,25,27,28,29)
Standard InChI Key: PCQOIBJOKXSDEB-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
0.0809 0.2098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7955 0.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5074 0.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5074 -0.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7973 -1.0266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0809 -0.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6337 -1.0312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3483 -0.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0631 -1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7752 -0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7752 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0649 0.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3483 0.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2220 -1.0275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9367 -0.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6515 -1.0273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3635 -0.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3635 0.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6532 0.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9367 0.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2220 0.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1485 -0.8703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1485 0.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6337 -0.2026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4898 0.6190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2044 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9190 0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9190 1.4442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2044 1.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4898 1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6337 1.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4898 -1.0315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4898 -1.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
6 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
4 14 1 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
3 21 1 0
17 22 1 0
18 23 1 0
23 24 2 0
24 22 1 0
25 11 1 0
25 26 1 0
27 26 1 0
28 27 1 0
29 28 1 0
25 30 1 0
30 29 1 0
28 31 1 0
10 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.54Molecular Weight (Monoisotopic): 444.2386AlogP: 3.91#Rotatable Bonds: 6Polar Surface Area: 94.23Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.82CX Basic pKa: 7.54CX LogP: 3.84CX LogD: 3.46Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.62
References 1. Chen X, Liu L, Liu P, Chen Y, Lin D, Yan H, Yan Q, Wang Y, Qiu Y, Fang B, Huang H, Qian J, Zhao Y, Du Z, Zhang Q, Li X, Zheng X, Liu Z.. (2022) Discovery of Potent and Orally Bioavailable Platelet-Derived Growth Factor Receptor (PDGFR) Inhibitors for the Treatment of Osteosarcoma., 65 (7.0): [PMID:35239349 ] [10.1021/acs.jmedchem.1c01732 ]