The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4R,5S)-4-((S)-3-(5-fluoro-1H-indol-3-yl)-2-((S)-2-(((5-(4-methoxyphenyl)-1-methyl-1H-pyrazol-4-yl)methyl)amino)-5-methylhexanamido)propanamido)-N,5-dimethylheptanamide ID: ALA5173242
PubChem CID: 168273484
Max Phase: Preclinical
Molecular Formula: C39H54FN7O4
Molecular Weight: 703.90
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@@H](CCC(=O)NC)NC(=O)[C@H](Cc1c[nH]c2ccc(F)cc12)NC(=O)[C@H](CCC(C)C)NCc1cnn(C)c1-c1ccc(OC)cc1
Standard InChI: InChI=1S/C39H54FN7O4/c1-8-25(4)32(17-18-36(48)41-5)45-39(50)35(19-27-21-42-33-16-12-29(40)20-31(27)33)46-38(49)34(15-9-24(2)3)43-22-28-23-44-47(6)37(28)26-10-13-30(51-7)14-11-26/h10-14,16,20-21,23-25,32,34-35,42-43H,8-9,15,17-19,22H2,1-7H3,(H,41,48)(H,45,50)(H,46,49)/t25-,32+,34-,35-/m0/s1
Standard InChI Key: DXDMYQKEGXRPSV-CPJXHTSBSA-N
Molfile:
RDKit 2D
51 54 0 0 0 0 0 0 0 0999 V2000
-4.2135 -0.2015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4990 0.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4990 1.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7843 -0.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0696 0.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3549 -0.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6402 0.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6402 1.0361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0744 -0.2017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7891 0.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5038 -0.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2185 0.2109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9332 -0.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6479 0.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3626 -0.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0773 0.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7920 -0.2017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5067 0.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0773 1.0361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9332 -1.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6479 -1.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6479 -2.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2185 -1.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5038 -1.0269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7891 1.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5038 1.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5900 2.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3968 2.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8093 1.7263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2573 1.1132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6526 3.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0973 3.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2948 3.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0401 2.8806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7113 4.2489 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.3549 -1.0269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0696 -1.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0696 -2.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4023 -2.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6572 -3.5342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4821 -3.5342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7370 -2.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5341 -2.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7486 -1.7355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5465 -1.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1260 -2.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9124 -2.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1179 -3.1195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9232 -1.8948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5067 -2.4784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8947 -4.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
13 12 1 6
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
16 19 2 0
13 20 1 0
20 21 1 0
21 22 1 0
20 23 1 6
11 24 2 0
10 25 1 1
25 26 1 0
27 26 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 26 2 0
28 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
27 34 1 0
33 35 1 0
6 36 1 1
36 37 1 0
37 38 1 0
39 38 1 0
39 40 2 0
40 41 1 0
41 42 1 0
42 38 2 0
43 42 1 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 48 1 0
48 43 2 0
46 49 1 0
49 50 1 0
41 51 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 703.90Molecular Weight (Monoisotopic): 703.4221AlogP: 5.40#Rotatable Bonds: 19Polar Surface Area: 142.17Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.56CX Basic pKa: 7.67CX LogP: 5.06CX LogD: 4.60Aromatic Rings: 4Heavy Atoms: 51QED Weighted: 0.09Np Likeness Score: -0.47
References 1. Proj M, Bozovičar K, Hrast M, Frlan R, Gobec S.. (2022) DNA-encoded library screening on two validated enzymes of the peptidoglycan biosynthetic pathway., 73 [PMID:35917835 ] [10.1016/j.bmcl.2022.128915 ]