The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-(tert-butyl)isoxazol-3-yl)-3-(4-(2-(phenylsulfonyl)-4,5-dihydro-2H-imidazo[2',1':2,3]thiazolo[4,5-e]isoindol-8-yl)phenyl)urea ID: ALA5173318
PubChem CID: 168276439
Max Phase: Preclinical
Molecular Formula: C31H28N6O4S2
Molecular Weight: 612.74
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3cn4c5c(sc4n3)CCc3cn(S(=O)(=O)c4ccccc4)cc3-5)cc2)no1
Standard InChI: InChI=1S/C31H28N6O4S2/c1-31(2,3)26-15-27(35-41-26)34-29(38)32-21-12-9-19(10-13-21)24-18-37-28-23-17-36(43(39,40)22-7-5-4-6-8-22)16-20(23)11-14-25(28)42-30(37)33-24/h4-10,12-13,15-18H,11,14H2,1-3H3,(H2,32,34,35,38)
Standard InChI Key: JLHKDOXRJWIAFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 49 0 0 0 0 0 0 0 0999 V2000
-2.3198 -2.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6053 -2.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8908 -2.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8908 -3.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6053 -4.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3198 -3.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1062 -4.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3786 -3.4060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1062 -2.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2033 -3.4060 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.6157 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2035 -1.9773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6153 -1.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4403 -1.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8520 -1.9755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4440 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2033 -4.2322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9171 -3.8191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7768 -1.7740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9328 -2.4414 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.7686 -0.8809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0542 -0.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4412 -1.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0542 0.3562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7684 0.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7676 1.5911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0531 2.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3416 1.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3369 0.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0531 2.8283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3389 3.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6247 2.8283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3389 4.0654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0895 3.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1757 4.0605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9820 4.2319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3942 3.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8425 2.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2190 3.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6314 4.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2190 2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9328 3.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
4 7 2 0
8 7 1 0
9 8 1 0
3 9 2 0
8 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
10 17 2 0
10 18 2 0
2 19 1 0
20 19 1 0
21 20 1 0
1 21 1 0
20 22 2 0
22 23 1 0
23 24 2 0
19 24 1 0
25 23 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
28 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
36 35 2 0
36 37 1 0
37 38 1 0
38 39 2 0
39 35 1 0
38 40 1 0
40 41 1 0
40 42 1 0
40 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 612.74Molecular Weight (Monoisotopic): 612.1613AlogP: 6.80#Rotatable Bonds: 5Polar Surface Area: 123.53Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.27CX Basic pKa: 3.83CX LogP: 6.67CX LogD: 6.62Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.22Np Likeness Score: -1.66
References 1. Cilibrasi V, Spanò V, Bortolozzi R, Barreca M, Raimondi MV, Rocca R, Maruca A, Montalbano A, Alcaro S, Ronca R, Viola G, Barraja P.. (2022) Synthesis of 2H-Imidazo[2',1':2,3] [1,3]thiazolo[4,5-e]isoindol-8-yl-phenylureas with promising therapeutic features for the treatment of acute myeloid leukemia (AML) with FLT3/ITD mutations., 235 [PMID:35339838 ] [10.1016/j.ejmech.2022.114292 ]