The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-Carbamoyl-1-((S)-2-hydroxy-2-phenylethyl)-1H-benzo[d]imidazol-2-yl)-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-3-carboxamide ID: ALA5174796
PubChem CID: 165146896
Max Phase: Preclinical
Molecular Formula: C29H28N6O4
Molecular Weight: 524.58
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1ccc2c(c1)nc(NC(=O)c1nn(C3CCCCO3)c3ccccc13)n2C[C@@H](O)c1ccccc1
Standard InChI: InChI=1S/C29H28N6O4/c30-27(37)19-13-14-23-21(16-19)31-29(34(23)17-24(36)18-8-2-1-3-9-18)32-28(38)26-20-10-4-5-11-22(20)35(33-26)25-12-6-7-15-39-25/h1-5,8-11,13-14,16,24-25,36H,6-7,12,15,17H2,(H2,30,37)(H,31,32,38)/t24-,25?/m1/s1
Standard InChI Key: AGSOOHNCSBODEH-IKOFQBKESA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
-3.3614 -0.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3625 -1.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6497 -2.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9379 -1.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9382 -0.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6515 -0.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1545 -0.7102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6698 -1.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1540 -2.0436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1528 -1.3765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5639 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3866 -0.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8675 -1.3286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6499 -1.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6496 -0.2514 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8670 0.0024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1523 0.0484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9004 0.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4512 0.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1972 1.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3865 1.6334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1325 2.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6834 3.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4917 2.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7420 2.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2558 0.5120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0753 -2.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0759 -3.0272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7875 -1.7926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3622 0.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3622 0.9829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0749 -0.2514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0749 1.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7875 0.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7875 0.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2592 -1.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0886 -2.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3109 -2.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6963 -2.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
5 4 1 0
5 6 2 0
6 1 1 0
7 5 1 0
8 7 1 0
9 8 2 0
4 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
11 17 2 0
7 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 1 1
2 27 1 0
27 28 2 0
27 29 1 0
15 30 1 0
30 31 1 0
30 32 1 0
31 33 1 0
32 34 1 0
33 35 1 0
34 35 1 0
14 36 1 0
37 36 2 0
38 37 1 0
39 38 2 0
13 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.58Molecular Weight (Monoisotopic): 524.2172AlogP: 4.17#Rotatable Bonds: 7Polar Surface Area: 137.29Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.76CX Basic pKa: 1.26CX LogP: 3.94CX LogD: 3.94Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.09
References 1. Jeon MJ, Lee H, Lee J, Baek SY, Lee D, Jo S, Lee JY, Kang M, Jung HR, Han SB, Kim NJ, Lee S, Kim H.. (2022) Development of Potent Immune Modulators Targeting Stimulator of Interferon Genes Receptor., 65 (7.0): [PMID:35315650 ] [10.1021/acs.jmedchem.1c01795 ]