N-(5-Carbamoyl-1-((S)-2-hydroxy-2-phenylethyl)-1H-benzo[d]imidazol-2-yl)-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-3-carboxamide

ID: ALA5174796

PubChem CID: 165146896

Max Phase: Preclinical

Molecular Formula: C29H28N6O4

Molecular Weight: 524.58

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)c1ccc2c(c1)nc(NC(=O)c1nn(C3CCCCO3)c3ccccc13)n2C[C@@H](O)c1ccccc1

Standard InChI:  InChI=1S/C29H28N6O4/c30-27(37)19-13-14-23-21(16-19)31-29(34(23)17-24(36)18-8-2-1-3-9-18)32-28(38)26-20-10-4-5-11-22(20)35(33-26)25-12-6-7-15-39-25/h1-5,8-11,13-14,16,24-25,36H,6-7,12,15,17H2,(H2,30,37)(H,31,32,38)/t24-,25?/m1/s1

Standard InChI Key:  AGSOOHNCSBODEH-IKOFQBKESA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   -3.3614   -0.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3625   -1.7937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6497   -2.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9379   -1.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9382   -0.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6515   -0.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1545   -0.7102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6698   -1.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1540   -2.0436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1528   -1.3765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5639   -0.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3866   -0.6635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8675   -1.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6499   -1.0741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6496   -0.2514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8670    0.0024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1523    0.0484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9004    0.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4512    0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1972    1.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3865    1.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1325    2.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6834    3.0272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4917    2.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7420    2.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2558    0.5120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0753   -2.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0759   -3.0272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7875   -1.7926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3622    0.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3622    0.9829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0749   -0.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0749    1.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7875    0.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7875    0.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2592   -1.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0886   -2.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3109   -2.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6963   -2.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  5  4  1  0
  5  6  2  0
  6  1  1  0
  7  5  1  0
  8  7  1  0
  9  8  2  0
  4  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 12  2  0
 11 17  2  0
  7 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  1  1
  2 27  1  0
 27 28  2  0
 27 29  1  0
 15 30  1  0
 30 31  1  0
 30 32  1  0
 31 33  1  0
 32 34  1  0
 33 35  1  0
 34 35  1  0
 14 36  1  0
 37 36  2  0
 38 37  1  0
 39 38  2  0
 13 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5174796

    ---

Associated Targets(Human)

STING1 Tchem Stimulator of interferon genes protein (1885 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
THP1-Dual (100 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.58Molecular Weight (Monoisotopic): 524.2172AlogP: 4.17#Rotatable Bonds: 7
Polar Surface Area: 137.29Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.76CX Basic pKa: 1.26CX LogP: 3.94CX LogD: 3.94
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.09

References

1. Jeon MJ, Lee H, Lee J, Baek SY, Lee D, Jo S, Lee JY, Kang M, Jung HR, Han SB, Kim NJ, Lee S, Kim H..  (2022)  Development of Potent Immune Modulators Targeting Stimulator of Interferon Genes Receptor.,  65  (7.0): [PMID:35315650] [10.1021/acs.jmedchem.1c01795]

Source