3beta-hydroxyrus-12,19(29)-dien-28-oic acid

ID: ALA517522

PubChem CID: 21670092

Max Phase: Preclinical

Molecular Formula: C30H46O3

Molecular Weight: 454.70

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C(=O)O)CC[C@H]1C

Standard InChI:  InChI=1S/C30H46O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18,21-24,31H,2,9-17H2,1,3-7H3,(H,32,33)/t18-,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1

Standard InChI Key:  VPMTUSRUIJFRMW-XCYSCKFXSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -3.1105   -1.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1105   -2.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3980   -2.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3980   -0.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6855   -1.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6844   -2.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9729   -2.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2578   -2.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9750   -0.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2632   -1.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2554    0.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9742   -0.1626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4564   -0.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4458   -0.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1512   -1.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8716   -1.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1724    0.2343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8831   -0.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6042    0.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6207    1.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9100    1.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1826    1.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8187   -3.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9931   -3.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8249   -2.6404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6929   -0.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2710   -0.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4378   -1.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1675   -0.5879    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5935   -0.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4743    1.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9250    2.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5940   -1.4245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3078   -0.1941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9799   -1.8096    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6887   -3.0480    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 16 18  1  0
 17 18  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
  5  4  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  5  6  1  0
  3 23  1  0
  3 24  1  0
  9 12  1  0
  2 25  1  1
 10 14  1  0
  5 26  1  1
 13 11  2  0
 10 27  1  1
 11 12  1  0
 14 28  1  6
 13 14  1  0
 17 29  1  1
  1  2  1  0
 18 30  1  1
  1  4  1  0
 22 31  2  0
  2  3  1  0
 21 32  1  6
  5  9  1  0
 13 17  1  0
 30 33  1  0
 30 34  2  0
 14 15  1  0
  9 35  1  6
 15 16  1  0
  6 36  1  6
M  END

Alternative Forms

Associated Targets(non-human)

Polb DNA polymerase beta (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.70Molecular Weight (Monoisotopic): 454.3447AlogP: 7.01#Rotatable Bonds: 1
Polar Surface Area: 57.53Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.71CX Basic pKa: CX LogP: 6.23CX LogD: 3.61
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: 3.29

References

1. Deng JZ, Starck SR, Hecht SM..  (1999)  DNA polymerase beta inhibitors from Baeckea gunniana.,  62  (12): [PMID:10654412] [10.1021/np990240w]

Source