The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5175530
PubChem CID: 129056976
Max Phase: Preclinical
Molecular Formula: C26H33N3O2
Molecular Weight: 419.57
Associated Items:
Names and Identifiers Canonical SMILES: CCCN1CCN(c2ccc3c(c2)C2CC3CCN2C(=O)OCc2ccccc2)CC1
Standard InChI: InChI=1S/C26H33N3O2/c1-2-11-27-13-15-28(16-14-27)22-8-9-23-21-10-12-29(25(17-21)24(23)18-22)26(30)31-19-20-6-4-3-5-7-20/h3-9,18,21,25H,2,10-17,19H2,1H3
Standard InChI Key: FFCRKESJGXTNRJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-1.2956 -1.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5810 -0.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1308 -1.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1308 -1.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5792 -2.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2956 -1.9051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9155 -2.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9155 -0.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4005 -1.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9697 -0.7173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5224 -1.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1420 -1.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0102 -0.6640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7249 -1.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4395 -0.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4395 0.1611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7249 0.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0102 0.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1541 0.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8688 0.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5834 0.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1833 0.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5998 0.6631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9804 0.2932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1939 1.0903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9910 1.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2048 2.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9997 2.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5834 1.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3724 0.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5770 0.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
3 8 1 0
8 9 1 0
9 7 1 0
8 10 1 0
10 11 1 0
7 12 1 0
11 12 1 0
1 13 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
13 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
10 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.57Molecular Weight (Monoisotopic): 419.2573AlogP: 4.79#Rotatable Bonds: 5Polar Surface Area: 36.02Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.46CX LogP: 4.68CX LogD: 3.59Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.70Np Likeness Score: -0.56
References 1. Walby GD, Martin SF.. (2022) Preparation of novel analogs of 2-arylpiperidines and evaluation of their sigma receptor binding affinities., 235 [PMID:35395511 ] [10.1016/j.ejmech.2022.114310 ]