ID: ALA5175530

PubChem CID: 129056976

Max Phase: Preclinical

Molecular Formula: C26H33N3O2

Molecular Weight: 419.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCN1CCN(c2ccc3c(c2)C2CC3CCN2C(=O)OCc2ccccc2)CC1

Standard InChI:  InChI=1S/C26H33N3O2/c1-2-11-27-13-15-28(16-14-27)22-8-9-23-21-10-12-29(25(17-21)24(23)18-22)26(30)31-19-20-6-4-3-5-7-20/h3-9,18,21,25H,2,10-17,19H2,1H3

Standard InChI Key:  FFCRKESJGXTNRJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -1.2956   -1.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5810   -0.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1308   -1.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1308   -1.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5792   -2.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2956   -1.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9155   -2.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9155   -0.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4005   -1.4888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9697   -0.7173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5224   -1.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1420   -1.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0102   -0.6640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7249   -1.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4395   -0.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4395    0.1611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7249    0.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0102    0.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1541    0.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8688    0.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5834    0.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1833    0.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5998    0.6631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9804    0.2932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1939    1.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9910    1.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2048    2.1010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9997    2.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5834    1.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3724    0.9359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5770    0.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  1  0
  9  7  1  0
  8 10  1  0
 10 11  1  0
  7 12  1  0
 11 12  1  0
  1 13  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 10 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5175530

    ---

Associated Targets(Human)

SIGMAR1 Tclin Sigma opioid receptor (6358 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TMEM97 Tchem Sigma intracellular receptor 2 (973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Tmem97 Sigma intracellular receptor 2 (922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.57Molecular Weight (Monoisotopic): 419.2573AlogP: 4.79#Rotatable Bonds: 5
Polar Surface Area: 36.02Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.46CX LogP: 4.68CX LogD: 3.59
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.70Np Likeness Score: -0.56

References

1. Walby GD, Martin SF..  (2022)  Preparation of novel analogs of 2-arylpiperidines and evaluation of their sigma receptor binding affinities.,  235  [PMID:35395511] [10.1016/j.ejmech.2022.114310]

Source