The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(4-(3-(2-fluoroethoxy)phenyl)piperazin-1-yl)butyl)-3-methylindolin-2-one ID: ALA5175774
PubChem CID: 154926523
Max Phase: Preclinical
Molecular Formula: C25H32FN3O2
Molecular Weight: 425.55
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(CCCCN2CCN(c3cccc(OCCF)c3)CC2)C(=O)Nc2ccccc21
Standard InChI: InChI=1S/C25H32FN3O2/c1-25(22-9-2-3-10-23(22)27-24(25)30)11-4-5-13-28-14-16-29(17-15-28)20-7-6-8-21(19-20)31-18-12-26/h2-3,6-10,19H,4-5,11-18H2,1H3,(H,27,30)
Standard InChI Key: BMTOSQYZCKOQEH-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-0.2859 -0.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6334 0.6879 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1523 1.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6494 1.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9701 0.5008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5157 -0.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7719 0.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0926 -0.3008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8944 -0.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2418 -1.1026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0436 -1.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3751 -1.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1768 -1.9975 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.3755 0.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0280 1.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2530 1.0888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4085 0.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8895 0.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6913 0.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1456 -0.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9474 -0.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 -1.1294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6958 -0.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9363 -1.3967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1768 0.0198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7225 0.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9474 0.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3594 0.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5465 1.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2949 1.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8827 1.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
9 14 1 0
14 15 2 0
15 16 1 0
16 7 2 0
17 2 1 0
18 17 1 0
19 18 1 0
19 20 1 0
21 20 1 0
21 23 1 0
23 24 2 0
25 23 1 0
26 25 1 0
26 27 1 0
27 21 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 26 2 0
21 22 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.55Molecular Weight (Monoisotopic): 425.2479AlogP: 4.24#Rotatable Bonds: 9Polar Surface Area: 44.81Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.25CX Basic pKa: 8.34CX LogP: 4.56CX LogD: 3.57Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -0.76
References 1. Fu H, Rong J, Chen Z, Zhou J, Collier T, Liang SH.. (2022) Positron Emission Tomography (PET) Imaging Tracers for Serotonin Receptors., 65 (16.0): [PMID:35939391 ] [10.1021/acs.jmedchem.2c00633 ]