3-(4-(4-(3-(2-fluoroethoxy)phenyl)piperazin-1-yl)butyl)-3-methylindolin-2-one

ID: ALA5175774

PubChem CID: 154926523

Max Phase: Preclinical

Molecular Formula: C25H32FN3O2

Molecular Weight: 425.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(CCCCN2CCN(c3cccc(OCCF)c3)CC2)C(=O)Nc2ccccc21

Standard InChI:  InChI=1S/C25H32FN3O2/c1-25(22-9-2-3-10-23(22)27-24(25)30)11-4-5-13-28-14-16-29(17-15-28)20-7-6-8-21(19-20)31-18-12-26/h2-3,6-10,19H,4-5,11-18H2,1H3,(H,27,30)

Standard InChI Key:  BMTOSQYZCKOQEH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -0.2859   -0.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6334    0.6879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1523    1.3293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6494    1.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9701    0.5008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5157   -0.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7719    0.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0926   -0.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8944   -0.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2418   -1.1026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0436   -1.1828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3751   -1.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1768   -1.9975    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.3755    0.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0280    1.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2530    1.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4085    0.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8895    0.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6913    0.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1456   -0.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9474   -0.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6267   -1.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6958   -0.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9363   -1.3967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1768    0.0198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7225    0.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9474    0.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3594    0.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5465    1.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2949    1.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8827    1.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  9 14  1  0
 14 15  2  0
 15 16  1  0
 16  7  2  0
 17  2  1  0
 18 17  1  0
 19 18  1  0
 19 20  1  0
 21 20  1  0
 21 23  1  0
 23 24  2  0
 25 23  1  0
 26 25  1  0
 26 27  1  0
 27 21  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 26  2  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5175774

    ---

Associated Targets(non-human)

Htr7 Serotonin 7 (5-HT7) receptor (811 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.55Molecular Weight (Monoisotopic): 425.2479AlogP: 4.24#Rotatable Bonds: 9
Polar Surface Area: 44.81Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.25CX Basic pKa: 8.34CX LogP: 4.56CX LogD: 3.57
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -0.76

References

1. Fu H, Rong J, Chen Z, Zhou J, Collier T, Liang SH..  (2022)  Positron Emission Tomography (PET) Imaging Tracers for Serotonin Receptors.,  65  (16.0): [PMID:35939391] [10.1021/acs.jmedchem.2c00633]

Source