The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(4-Benzhydrylpiperazin-1-yl)butyl)-N-hydroxybenzamide ID: ALA5175813
PubChem CID: 168276122
Max Phase: Preclinical
Molecular Formula: C28H33N3O2
Molecular Weight: 443.59
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NO)c1ccc(CCCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C28H33N3O2/c32-28(29-33)26-16-14-23(15-17-26)9-7-8-18-30-19-21-31(22-20-30)27(24-10-3-1-4-11-24)25-12-5-2-6-13-25/h1-6,10-17,27,33H,7-9,18-22H2,(H,29,32)
Standard InChI Key: VESYDOZDDMFQMJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.2889 -1.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5848 -1.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6073 -2.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3292 -3.1661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0310 -2.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0145 -1.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2663 -0.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9656 -0.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6912 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3894 -0.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3716 0.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6461 0.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9406 0.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5445 -0.3137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5242 0.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7987 0.8994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0935 0.4716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1209 -0.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8465 -0.7453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3716 0.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3274 0.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0494 0.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7486 0.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4705 0.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1720 0.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8939 0.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9178 1.5674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2199 2.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4943 1.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6396 1.9582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3387 1.5222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6675 2.7754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3894 3.1661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
1 6 1 0
1 7 1 0
8 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
8 13 1 0
7 14 1 0
15 14 1 0
16 15 1 0
17 16 1 0
17 18 1 0
14 19 1 0
19 18 1 0
17 20 1 0
21 20 1 0
22 21 1 0
23 22 1 0
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
27 28 1 0
24 29 1 0
29 28 2 0
27 30 1 0
30 31 2 0
30 32 1 0
33 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.59Molecular Weight (Monoisotopic): 443.2573AlogP: 4.54#Rotatable Bonds: 9Polar Surface Area: 55.81Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.27CX Basic pKa: 8.35CX LogP: 4.99CX LogD: 4.24Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: -0.89
References 1. Hashimoto K, Ide S, Arata M, Nakata A, Ito A, Ito TK, Kudo N, Lin B, Nunomura K, Tsuganezawa K, Yoshida M, Nagaoka Y, Sumiyoshi T.. (2022) Discovery of Benzylpiperazine Derivatives as CNS-Penetrant and Selective Histone Deacetylase 6 Inhibitors., 13 (7.0): [PMID:35859864 ] [10.1021/acsmedchemlett.2c00081 ]