(S)-N-(3-fluorophenyl)-1-(3-(4-((3-methylpiperazin-1-yl)methyl)phenyl)pyridin-2-yl)piperidin-4-amine

ID: ALA5175905

PubChem CID: 168274082

Max Phase: Preclinical

Molecular Formula: C28H34FN5

Molecular Weight: 459.61

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H]1CN(Cc2ccc(-c3cccnc3N3CCC(Nc4cccc(F)c4)CC3)cc2)CCN1

Standard InChI:  InChI=1S/C28H34FN5/c1-21-19-33(17-14-30-21)20-22-7-9-23(10-8-22)27-6-3-13-31-28(27)34-15-11-25(12-16-34)32-26-5-2-4-24(29)18-26/h2-10,13,18,21,25,30,32H,11-12,14-17,19-20H2,1H3/t21-/m0/s1

Standard InChI Key:  OXXACWCGCOROBD-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -3.5705    1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8561    2.0629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1415    1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1415    0.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8561    0.4128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5705    0.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8561   -0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1417   -0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7156   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7156   -1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4255   -2.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1417   -1.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273    2.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0012   -2.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -1.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4248   -2.0609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4248   -2.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149   -3.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0012   -2.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -0.8243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0011   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0011    0.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131    0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4274    0.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4274   -0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131    1.6499    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4274    2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4276    2.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1401    3.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8547    2.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8562    2.0644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1447    1.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5705    1.6520    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  5  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
  3 14  1  1
 11 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 16 21  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 21 26  1  0
 24 27  1  0
 27 28  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5175905

    ---

Associated Targets(Human)

MLNR Tchem Motilin receptor (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.61Molecular Weight (Monoisotopic): 459.2798AlogP: 4.76#Rotatable Bonds: 6
Polar Surface Area: 43.43Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.37CX LogP: 4.35CX LogD: 2.37
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -1.35

References

1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M..  (2022)  Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure.,  59  [PMID:35051575] [10.1016/j.bmcl.2022.128554]

Source