The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-fluorophenyl)-1-(3-(4-((3-methylpiperazin-1-yl)methyl)phenyl)pyridin-2-yl)piperidin-4-amine ID: ALA5175905
PubChem CID: 168274082
Max Phase: Preclinical
Molecular Formula: C28H34FN5
Molecular Weight: 459.61
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1CN(Cc2ccc(-c3cccnc3N3CCC(Nc4cccc(F)c4)CC3)cc2)CCN1
Standard InChI: InChI=1S/C28H34FN5/c1-21-19-33(17-14-30-21)20-22-7-9-23(10-8-22)27-6-3-13-31-28(27)34-15-11-25(12-16-34)32-26-5-2-4-24(29)18-26/h2-10,13,18,21,25,30,32H,11-12,14-17,19-20H2,1H3/t21-/m0/s1
Standard InChI Key: OXXACWCGCOROBD-NRFANRHFSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-3.5705 1.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8561 2.0629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1415 1.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1415 0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8561 0.4128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5705 0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8561 -0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1417 -0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4273 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7156 -0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7156 -1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4255 -2.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1417 -1.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4273 2.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0012 -2.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -1.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4248 -2.0609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4248 -2.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7149 -3.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0012 -2.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -0.8243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0011 -0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0011 0.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4274 0.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4274 -0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 1.6499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4274 2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 2.8872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1401 3.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8547 2.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8562 2.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1447 1.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5705 1.6520 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
3 14 1 1
11 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
16 21 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
26 25 1 0
21 26 1 0
24 27 1 0
27 28 1 0
29 28 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.61Molecular Weight (Monoisotopic): 459.2798AlogP: 4.76#Rotatable Bonds: 6Polar Surface Area: 43.43Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.37CX LogP: 4.35CX LogD: 2.37Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -1.35
References 1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M.. (2022) Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure., 59 [PMID:35051575 ] [10.1016/j.bmcl.2022.128554 ]