The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-Ethyl-3-methyl-1H-pyrazole-5-carboxamido)-7-(3-(1-ethyl-3-methyl-1H-pyrazole-5-carboxamido)propoxy)-1-methyl-1H-benzo[d]imidazole-5-carboxamide ID: ALA5176115
PubChem CID: 168276131
Max Phase: Preclinical
Molecular Formula: C26H33N9O4
Molecular Weight: 535.61
Associated Items:
Names and Identifiers Canonical SMILES: CCn1nc(C)cc1C(=O)NCCCOc1cc(C(N)=O)cc2nc(NC(=O)c3cc(C)nn3CC)n(C)c12
Standard InChI: InChI=1S/C26H33N9O4/c1-6-34-19(11-15(3)31-34)24(37)28-9-8-10-39-21-14-17(23(27)36)13-18-22(21)33(5)26(29-18)30-25(38)20-12-16(4)32-35(20)7-2/h11-14H,6-10H2,1-5H3,(H2,27,36)(H,28,37)(H,29,30,38)
Standard InChI Key: SZRWWBFZIKGCGY-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
-1.0556 -0.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0568 -1.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3441 -2.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3677 -1.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3674 -0.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3459 -0.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3459 0.3581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0584 0.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1510 -0.6177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6357 -1.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1514 -1.9511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4582 -1.2839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8693 -0.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6919 -0.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1729 -1.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9551 -0.9816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9548 -0.1589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1724 0.0948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9594 0.8895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5412 1.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6677 -1.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4577 0.1408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4049 0.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7695 -2.1119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7702 -2.9345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4816 -1.7001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0584 1.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7710 2.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4836 1.5922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1961 2.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9087 1.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1961 2.8265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9946 0.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7992 0.6034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2103 1.3156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6599 1.9268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8729 2.7216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6677 2.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2106 -0.1091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
5 4 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
9 5 1 0
10 9 1 0
11 10 2 0
4 11 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
18 19 1 0
19 20 1 0
16 21 1 0
13 22 2 0
9 23 1 0
2 24 1 0
24 25 2 0
24 26 1 0
8 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
33 31 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 31 1 0
36 37 1 0
37 38 1 0
34 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.61Molecular Weight (Monoisotopic): 535.2656AlogP: 2.17#Rotatable Bonds: 11Polar Surface Area: 163.98Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.34CX Basic pKa: 2.10CX LogP: 0.56CX LogD: 0.56Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -1.37
References 1. Jeon MJ, Lee H, Lee J, Baek SY, Lee D, Jo S, Lee JY, Kang M, Jung HR, Han SB, Kim NJ, Lee S, Kim H.. (2022) Development of Potent Immune Modulators Targeting Stimulator of Interferon Genes Receptor., 65 (7.0): [PMID:35315650 ] [10.1021/acs.jmedchem.1c01795 ]